If A is an 8 times 6 matrix, what is the largest possible rank of A? If A is a 6 times 8 matrix, what is the largest possible rank of A? Explain your answers. Select the correct choice below and fill in the answer box(es) to complete your choice. A. The rank of A is equal to the number of pivot positions in A. Since there are only 6 columns in an 8 times 6 matrix, and there are only 6 rows in a 6 times 8 matrix, there can be at most pivot positions for either matrix. Therefore, the largest possible rank of either matrix is B. The rank of A is equal to the number of non-pivot columns in A. Since there are more rows than columns in an 8 times 6 matrix, the rank of an 8 times 6 matrix must be equal to. Since there are 6 rows in a 6 times 8 matrix, there are a maximum of 6 pivot positions in A. Thus, there are 2 non-pivot columns. Therefore, the largest possible rank of a 6 times 8 matrix is C. The rank of A is equal to the number of columns of A. Since there are 6 columns in an 8 times 6 matrix, the largest possible rank of an 8 times 6 matrix is. Since there are 8 columns in a 6 times 8 matrix, the largest possible rank of a 6 times 8 matrix is.

Answers

Answer 1

The correct choice is:

B. The rank of A is equal to the number of non-pivot columns in A. Since there are more rows than columns in an 8 times 6 matrix, the rank of an 8 times 6 matrix must be equal to the number of columns, which is 6.

Since there are 6 rows in a 6 times 8 matrix, there can be at most 6 pivot positions in A. Thus, there are 2 non-pivot columns. Therefore, the largest possible rank of a 6 times 8 matrix is 6.

The rank of a matrix represents the maximum number of linearly independent rows or columns in that matrix. It is also equal to the number of pivot positions (leading non-zero entries) in the row-echelon form of the matrix.

For an 8x6 matrix, the maximum number of pivot positions can be at most 6 because there are only 6 columns. Therefore, the largest possible rank of an 8x6 matrix is 6.

On the other hand, for a 6x8 matrix, there can be at most 6 pivot positions since there are only 6 rows. This means there are 2 non-pivot columns (total columns - pivot positions = 8 - 6 = 2). Thus, the largest possible rank of a 6x8 matrix is 6.

In summary, the rank of a matrix is determined by the number of pivot positions, and it cannot exceed the number of columns in the case of an 8x6 matrix or the number of rows in the case of a 6x8 matrix.

Learn more about Pivot Matrix at

brainly.com/question/18365555

#SPJ4


Related Questions

cos80°.cos10°-sin80°.sin10°​

Answers

Step-by-step explanation:

The answer will be zero

here are the steps:

cos(90-10)xcos(90-80)-sin(90-10)xsin(90-10)=

(cos10xcos10)-(sin80xsin80)=

0.965111-0.965111=0

have a good day :)

I hope it will benefit you.

Since the arithmetic mean of the above data is 20, what is the span?
A) 45. B) 40. C) 35. D) 30​

Answers

Answer:

Step-by-step explanation:

Find all of the eigenvalues of the matrix A over the complex numbers C. Give bases for each of the corresponding eigenspaces. A = [2 -1]
[ 1 2]
λ1 = ___ has eigenspace span (__) (λ-value with smaller imaginary part) λ2 ___ has eigenspace span (__) (A-value with larger imaginary part)

Answers

An eigenvector corresponding to λ₂ = 2 - i is v₂ = [-1, 1].

To find the eigenvalues of matrix A, we need to solve the characteristic equation det(A - λI) = 0, where I is the identity matrix.

Let's compute the determinant:

det(A - λI) = |[2 - λ -1]|

|[ 1 2 - λ]|

Expanding along the first row, we have:

(2 - λ)(2 - λ) - (-1)(1) = (2 - λ)² + 1 = λ² - 4λ + 5 = 0

To solve this quadratic equation, we can use the quadratic formula:

λ = (-(-4) ± √((-4)² - 4(1)(5))) / (2(1))

= (4 ± √(16 - 20)) / 2

= (4 ± √(-4)) / 2

Since we are working over the complex numbers, the square root of -4 is √(-4) = 2i.

λ₁ = (4 + 2i) / 2 = 2 + i

λ₂ = (4 - 2i) / 2 = 2 - i

Now, let's find the eigenvectors corresponding to each eigenvalue.

For λ₁ = 2 + i, we solve the equation (A - (2 + i)I)v = 0:

[2 - (2 + i) -1] [x] [0]

[ 1 2 - (2 + i)] [y] = [0]

Simplifying, we have:

[0 -1 -1] [x] [0]

[ 1 0 - i] [y] = [0]

From the first equation, we have -x - y = 0, which implies x = -y.

Choosing y = 1, we have x = -1.

Therefore, an eigenvector corresponding to λ₁ = 2 + i is v₁ = [-1, 1].

For λ₂ = 2 - i, we solve the equation (A - (2 - i)I)v = 0:

[2 - (2 - i) -1] [x] [0]

[ 1 2 - (2 - i)] [y] = [0]

Simplifying, we have:

[0 -1 -1] [x] [0]

[ 1 0 i] [y] = [0]

From the first equation, we have -x - y = 0, which implies x = -y.

Choosing y = 1, we have x = -1.

In summary:

λ₁ = 2 + i has eigenspace span {[-1, 1]}

λ₂ = 2 - i has eigenspace span {[-1, 1]}

Know more about eigenvector here:

https://brainly.com/question/31669528

#SPJ11

A curve with the equation Sin(x) – y Cos(x) = y passes through two points A(nt, a) and B(a, b) (a

Answers

The equation of the curve as, (y - a) = (b - a) (x - nt) / (a - nt) which is a straight line passing through the two given points, A(nt, a) and B(a, b).

Given: Two points A (e.g., a) and B (a, b) are traversed by the curve whose equation is Sin(x) – y Cos(x) = y (a Solution: (sin x - y cos x) = y Taking y to the left, we get (sin x) = (y y cos x) Again, we can write y as (y) = (sin x) / (1 cos x) Simplifying this even further, we get (y) = (sin x / 2) / (cos x/2) Substituting the values of x = nt A( eg, a) and B( a, b), we get the condition in the structure, y - a = (b - a) (x - ex.)/( a​​​​-ex.)

Tackling the above condition, we get the condition bend which is a straight line going through two given focuses A (eg, a) and B(a, b). As a result, we obtain a curve in the form of an equation (y - a) = (b - a) (x - nt) / (a) - nt), which is a straight line that runs through the two points A(eg, a) and B(a, b) that have been given to us.

To know more about curve refer to

https://brainly.com/question/32496411

#SPJ11

6th grade math help me pleaseeee

Answers

Answer:

3 CDs

Step-by-step explanation:

If we have $65 and buy a $23 DVD, we will have $42 left.

So how many $14 CDs can we buy with $42?

All we have to do is divide 42 into 14, so we know how many groups of $14 we can make with $42.

42 ÷ 14 = 3

Therefore, Michella can purchase 3 CDs.

Find the general solution of the following:

dy/dt + 4/ty = e^t/t^3

Answers

The general solution of the differential equation dy/dt + 4/ty = e raised to power of t/t raised to power of 3:

y = C * e raised to power of t * t raised to power of 4

where C is an arbitrary constant.

To find this solution, we can use the following steps:

First, we can factor out e raised to power of t/t raised to power 3 from the right-hand side of the equation. This gives us:

dy/dt + 4/ty = e raised to power t/t raised to power of 3 * (1/t)

Next, we can multiply both sides of the equation by ty to get:

dy + 4 = e raised to power of t/t raised to power of 2

Now, we can integrate both sides of the equation. This gives us:

y + 4t = C * e raised to power of t

Finally, we can solve for y to get the general solution:

y = C * e raised to power of t * t raised to power of 4

where C is an arbitrary constant.

The first step of the solution is to factor out e raised to power t/t raised to power of 3 from the right-hand side of the equation. This is possible because the derivative of e raised to power of t/t raised to power of 3 is e raised to power of t/t raised to power of 3 * (1/t).

The second step of the solution is to multiply both sides of the equation by ty to get dy + 4 = e raised to power of t/t raised to power of 2. This is possible because the derivative of ty is t + y.

The third step of the solution is to integrate both sides of the equation. This gives us y + 4t = C * e raised to power of t. This is possible because the integral of dy is y and the integral of e raised to power t/t raised to power of 2 is -2e raised to power of t/t + C.

The fourth step of the solution is to solve for y to get the general solution y = C * e raised to power t * t raised to power of 4. This is possible by dividing both sides of the equation by C * e raised to power of t.

To learn more about differential equations click brainly.com/question/14620493

#SPJ11

The scores on a psychology exam were normally distributed with a mean of 65 and a standard deviation of 6. What is the standard score for an exam score of 74?

Answers

Answer:

z = 1.5

Step-by-step explanation:

                               x - mean

standard score = -----------------

                                     6

Substituting 74 for x, 65 for mean, we get:

                               74 - 65

standard score = ----------------- = 9/6 = 1.5

                                     6

The pertinent z-score (standard score) is 1.5.

Answer:

Solution :-

Score = 74 - 65/6

Score = 9/6

Hence

Score is 9/6 or 1.5

[tex] \\ [/tex]

Circle | was dilated with the orgin as the center of dilation to create Circle ||.
Which rule best represents the dilation applied to Circle | to create Circle ||?

Answers

Step-by-step explanation:

The rule that best represents the dilation applied to Circle | to create Circle || is the scale factor. The scale factor determines the ratio of corresponding lengths between the original figure (Circle |) and the dilated figure (Circle ||).

In a dilation, all lengths in the original figure are multiplied by the scale factor to obtain the corresponding lengths in the dilated figure. This includes the radii of the circles.

For example, if the scale factor is 2, it means that every length in the original figure is doubled in the dilated figure. If the scale factor is 1/2, it means that every length is halved. The scale factor can be greater than 1, less than 1 (but greater than 0), or even negative, indicating a reflection.

In the context of the given scenario, since the origin is the center of dilation, the scale factor determines how the distances from the origin to any point on Circle | are scaled to obtain the corresponding distances on Circle ||.

Tell whether $x$ and $y$ are proportional. $x$ 0.25 0.5 0.75 $y$ 4 8 12

Answers

Answer:

x and y are proportional. Two quantities are proportional if there is a constant ratio between them. In this case, the ratio between y and x is always 16:

4/0.25=16

8/0.5=16

12/0.75=16

Since the ratio between y and x is always the same, x and y are proportional.

Step-by-step explanation:

8.

Find the area of the shaded region.


A. 5x2 – 11x + 16

B. 5x2 + 7x – 26

C. 5x2 + 11x – 12

D. 5x2 + 7x – 20

Answers

Area of the shaded region = area of big square minus area of little square.

Here is the set up:

Let A_s = area of shaded region.

A_s = (2x + 2)(3x - 4) - [(x - 3)(x - 6)]

Take it from here.

Answer:

B. 5x2 + 7x – 26

Step-by-step explanation:  keeping in mind that the area of a rectangle is simply width * length, if we get the area of the larger rectangle, and then subtract the area of the smaller rectangle, we're in effect making a hole in the larger rectangle's area and thus what's leftover is the shaded area.

.................................................................................................................................

Answer:

Area = 5x^2 +7x -26

Step-by-step explanation:

The area of the shaded region can be found if you substruct the small rectangle from the big one. The area of any rectangle is calculated if you multiply width and height.

In other words:

A_small = (x-3)(x-6) = x^2-9x +18

A_big = (2x+2)(3x-4) = 6x^2 -2x -8

A_big - A_small = (6x^2 -2x -8) - (x^2-9x +18)

= 6x^2 -2x -8 - x^2 + 9x -18

= 5x^2 +7x -26

et k be a real number and A=[1 k 9 1 2 3 2 5 7]. Then determinant of A is ?

Answers

The determinant of A is -23 - k.

In case, we have a 3x3 submatrix starting at element (1,1) and ending at element (3,3). Therefore, we can calculate the determinant using cofactor expansion method:

| 1 k 9 |

| 1 2 3 |

| 2 5 7 |

= 1| 2  3 | - k| 1  3 | + 9| 1  2 |

| 5  7 | | 5  7 | | 5  7 |

= 1(2(7) - 3(5)) - k(1(7) - 3(2)) + 9(1(7) - 2(5))

= 1(4) - k(1) + 9(-3)

= -23 - k

Therefore, the determinant of A is -23 - k.

Learn more about Determinant : https://brainly.com/question/14218479

#SPJ11

If difference scores begin to pile up away from a sample mean difference score of Mp= 0, which of the following statements is true? a. The critical region is small.
b. The null hypothesis will likely be rejected. c. The sample size is large. d. The null hypothesis will likely fail to be rejected.

Answers

If difference scores begin to pile up away from a sample mean difference score of Mp= 0, the null hypothesis will likely be rejected. So, correct option is B.

This suggests that there is a likely effect or relationship between the variables being compared.

Option b. The null hypothesis will likely be rejected is the correct statement in this scenario. When the observed differences are consistently far from zero, it implies that the null hypothesis, which assumes no significant difference or effect, is unlikely to be true.

Thus, based on the evidence provided by the data, we would reject the null hypothesis in favor of an alternative hypothesis that suggests the presence of a difference or effect.

The critical region refers to the region of extreme values that would lead to rejecting the null hypothesis. While the size of the critical region can vary depending on the chosen significance level, it does not directly indicate the likelihood of rejecting the null hypothesis in this context.

Similarly, the sample size (option c) does not provide information about the likelihood of rejecting the null hypothesis in this situation.

So, correct option is B.

To learn more about difference scores click on,

https://brainly.com/question/31492051

#SPJ4

The graph shown is a scatter plot:

A scatter plot is shown with the values on the x-axis in increasing units of 1 and the y-axis in increasing units of 10. The data moves in an upward cluster. Point A has coordinates 8 and 70. Point B has coordinates 1 and 20, point C has coordinates 3 and 40, point D has coordinates 7 and 30. Additional points are located at 2 and 10, 2 and 20, 3 and 30, 5 and 50, 5 and 40, 7 and 70, 7 and 60.
Which point on the scatter plot is an outlier? (4 points)

Group of answer choices

Point D

Point B

Point C

Point A

Answers

you’re answer is b.
i did this already

Answer:

D

Step-by-step explanation:

if we see on the graph, the point which is scattered is point D !
also took the FLVS test!!

Show that the following are equivalent, for Snopea filter Fonot todological Space X 9 f is if G is G an open set in C and CnH+ 0 s G for each Hef, then CEF c) iz G is G ° open and C & F, then X-cef ?

Answers

The given statement is true  (i) implies (ii) and (ii) implies (i).

The statement in the question that needs to be proven is :C & F, then X-cef = G is G an open set in C and CnH+ 0 s G for each Hef

We will prove that (i) implies (ii) and (ii) implies (i).

Proof: (i) C & F, then X-cef = G is G an open set in C and CnH+ 0 s G for each Hef

Let X \ {C & F} = U, then U is open, since C & F is closed.

Let H be any point of U.

By hypothesis, there exists an open set G such that CnH+ 0 s G.

Let x in G. If x ∈ C & F, then x ∉ H, so x ∉ U.

Thus, G ⊆ C, and so G ∩ U = ∅.

Hence, U is open(ii) G is G an open set in C and CnH+ 0 s G for each Hef

Let x ∈ X-C & F.

Then x ∉ C & F, so x ∉ C.

Since C is closed, there exists a neighborhood G of x that is disjoint from C.

Let H be any point of X-C & F.

Then H ∈ G and so CnH+ 0 s G.

Thus, C & F is closed.

Therefore, X-C & F is open, since C & F is closed.

Thus, X-C & F = G.

Hence, (ii) implies (i).

Therefore, the statement in the question is proven.

To learn more about open set

https://brainly.com/question/32510719

#SPJ11

sketch the strophoid shown below. r = sec() − 2 cos(), − 2 < < 2

Answers

The strophoid is a curve represented by the polar equation r = sec(θ) − 2cos(θ), where -2 < θ < 2. In Cartesian coordinates, the strophoid equation can be written as (x^2 + y^2)^2 = 4y^2(x + 2).

The strophoid has a unique shape characterized by its looped structure.

The strophoid is symmetric with respect to the y-axis, as changing θ to -θ gives the same value of r. It has two branches that intersect at the origin (0, 0). As θ increases from -2 to 2, the curve starts from the rightmost point of the loop, extends to the left, and then returns back to the rightmost point.

The loop of the strophoid is created by the interplay of the secant function, which stretches the curve away from the origin, and the cosine function, which pulls it towards the origin. The strophoid exhibits interesting geometric properties and is often used in mathematical modeling and visualization.

To learn more about intersect click here:

brainly.com/question/14217061

#SPJ11

If 491 households were surveyed out of which 343 households have internet fiber cable, what is the sample proportion of households without fiber cable is

Answers

The sample proportion of households without fiber cable can be calculated by subtracting the proportion of households with fiber cable from 1.

In this case, out of the 491 households surveyed, 343 households have internet fiber cable. To find the proportion of households without fiber cable, we subtract the proportion of households with fiber cable (343/491) from 1. The proportion of households without fiber cable is 1 - (343/491). Simplifying this expression, we get (491 - 343)/491 = 148/491.

Therefore, the sample proportion of households without fiber cable is 148/491, which is approximately 0.3012 or 30.12%. This means that in the surveyed sample, around 30.12% of households do not have internet fiber cable. It's important to note that this proportion represents the sample and not the entire population, as it is based on the households surveyed.

learn more about sample proportion here:

https://brainly.com/question/11461187

#SPJ11

6th grade math plz help

Answers

A is the answer I believe

The math club is selling T-shirts to raise money. Each T-shirt sold represents a profit of $2. The club has a total of 500 T-
shirts
If P() is the profit that the math club makes for selling T-shirts, a reasonable domain of this function is
<

Answers

Answer:

2 < or equal to (t) < or equal to 1000

Step-by-step explanation:

2 is the profit of the (t) amount of t shirts so the amount should be greater than or equal too 1000 because if they have 500 shirts 500 x 2 is 1000

The domain of this function will be given by the set A[1, 500].

What is the end behaviour of a function? What do you mean by domain and range of a function?

The end behavior of a function describes the trend of the graph if we look to the right end of the x-axis (as x approaches +∞ ) and to the left end of the x-axis (as x approaches −∞ ).

For any function y = f(x), Domain is the set of all possible values of [x] for which [y] exists. Range is the set of all values of [y] that exists for the given domain.

Given is the math club which is selling T-shirts to raise money. Each T-shirt sold represents a profit of $2. The club has a total of 500 T- shirts.

The function representing the profit by selling [x] T - shirts can be written as -

P(x) = 2x

or

y = 2x

Maximum value of y = 2x 500 = $1000

The domain of this function will be given by the set A[1, 500].

Hence, the domain of this function will be given by the set A[1, 500].

To solve more questions on functions, visit the link below -

brainly.com/question/1632425

#SPJ2

Please help me asap thanks

Answers

Answer:

x=3.5

Step-by-step explanation:

To make DEF similar to XYZ, the sides have to be in the same ratio. EF corresponds to YZ. EF=3, and YZ=4.5. The ratio 3:4.5 can be simplified to 2:3. Side DF corresponds to XZ.  DF=7 and XZ=3x. So, the ratio is 7:3x.

To  find x, we first find out what 3x is.  In this case 3x is 3(7/2)=10.5. So, x=10.5/3=3.5.

What is the area of the shaded region?
6 units

Answers

Answer:

Step-by-step explanation:

A cylinder with a radius of 12 cm and a height of 20 cm has the same volume as a cone with a radius of 8 cm. What is the height of the cone?
A) 95 cm
B) 115 cm
C) 125 cm
D) 135 cm

Answers

Answer:

its d

Step-by-step explanation:

Consider an upright cone that has a base radius of r and height h that has been obtained by revolving a triangular plane region (pictured below) about the y-axis. Apply the cylindrical shells method to con- Ty firm that the volume of the cone is V = arh. h + 0 r

Answers

By apply the cylindrical shells method proved that the volume of the cone is V = [tex]\frac{1}{3}[/tex]πr²h.

Given that,

Consider an upright cone that was generated by rotating the triangular plane region shown in the image about the y-axis. It has a base radius of r and a height of h.

We have to apply the cylindrical shells method to confirm that the volume of the cone is V = [tex]\frac{1}{3}[/tex]πr²h

We know that,

By using the disk method,

V = [tex]\int\limits^b_a {\pi [f(x)]^2} \, dx[/tex]

Differentiating on both the sides,

dV = π[f(x)]² dx

Integrating on both sides with the limits 0 to h

[tex]\int\limits^h_0 { dV }= \int\limits^h_0 {\pi[f(x)]^2 }dx[/tex]

V = [tex]\int\limits^h_0 {\pi \frac{r^2x^2}{h^2} } \, dx[/tex]

V = [tex]\pi \frac{r^2}{h^2}\int\limits^h_0 {x^2 } \, dx[/tex]

V = [tex]\pi \frac{r^2}{h^2}[\frac{x^3}{3}]^h_0[/tex]

V = [tex]\pi \frac{r^2}{h^2}[\frac{h^3}{3}][/tex]

V = [tex]\frac{1}{3}[/tex]πr²h

Therefore, By apply the cylindrical shells method proved that the volume of the cone is V = [tex]\frac{1}{3}[/tex]πr²h.

To know more about volume visit:

https://brainly.com/question/29767724

#SPJ4

From the equation, find the axis of symmetry of the parabola.
y = 2x^2 + 4 x - 1

a. x = 3
b. x = -1
c. x = -3
d. x = 1

PLEASE HURRY!!! WILL MARK AS BRAINLIEST!!!

Answers

Answer:

C

Step-by-step explanation:

Ur welcome

Two cheeseburgers and one small order of fries contain a total of 1400 calories. Three cheeseburgers and two small orders of fries contain a total of 2260 calories. Find the caloric content of each item.

Answers

Let the calories of a cheeseburger be C, and the calories of a small order of fries be F. Using this notation: Two cheeseburgers and one small order of fries contain a total of 1400 calories. Calories in 2 cheeseburgers + Calories in 1 small order of fries = 14002C + F = 1400. Three cheeseburgers and two small orders of fries contain a total of 2260 calories. Calories in 3 cheeseburgers + Calories in 2 small orders of fries = 22603C + 2F = 2260. We can solve for C and F by solving these two equations for C and F using the method of elimination.

Let's double the first equation and subtract the second equation: 4C + 2F = 2800  -(3C + 2F = 2260). 1C = 540  C = 540. Calories in a cheeseburger = C = 540. Substituting this value of C into either of the two equations and solving for F gives us:2C + F = 14002(540) + F = 1400. F = 320. Calories in a small order of fries = F = 320. Therefore, two cheeseburgers contain 2C = 2(540) = 1080 calories, and one small order of fries contains F = 320 calories. Three cheeseburgers contain 3C = 3(540) = 1620 calories, and two small orders of fries contain 2F = 2(320) = 640 calories.

Answer: Calories in a cheeseburger = C = 540Calories in a small order of fries = F = 320. Calories in two cheeseburgers = 2C = 2(540) = 1080. Calories in three cheeseburgers = 3C = 3(540) = 1620. Calories in one small order of fries = F = 320Calories in two small orders of fries = 2F = 2(320) = 640.

To know more about elimination method, click here:

https://brainly.com/question/13877817

#SPJ11

Arrange the following fraction from least to greatest 2/3, 5/6, 3/5
What did you do to arrange the fraction from least to greatest?

Answers

Answer:

2/3 and 3/5 is same, then 5/6

Step-by-step explanation:

you can convert the fractions to decimals to find their value and then arrange them from least to the greatest.

Answer:

3/5, 2/3, 5/6 [From Least to Greatest]

Step-by-step explanation:

First you're going to want to know which one is "the bigger piece of pie".

I made a few drawing and look at the pictures (Just in case you have a different opinion from my answer)

help!!!! ^^^ due in 20 mins!

Answers

Answer:

I believe its 60cm squared

I’m not sure

Answer:

i think its 60cm

Step-by-step explanation:

can someone help??!???!?!

Answers

Answer:

download discord

Answer:

im confused-

Step-by-step explanation:

a) SST represents the _____sum of squares.
b) SSTr represents the _____sum of squares.
c) SSE represents the _____sum of squares.

d) Which of the following statements is TRUE?
SSE = SSTr + SST
SST = SST - SSE
MSE = MST + MST
MST = MST + MSE
SST = SSTr + SSE
e) Which of the following represents the average between group variation?
σ
MSE
s
MST

Answers

a) SST represents the total sum of squares.

b) SSTr represents the treatment sum of squares.

c) SSE represents the error sum of squares.

d) The true statement is: SST = SSTr + SSE.

e) The average between-group variation is represented by MST (mean square treatment).

How to explain the information

a) SST (Total Sum of Squares) represents the total variation in the data. It measures the total deviation of each data point from the overall mean.

b) SSTr (Treatment Sum of Squares) represents the variation attributed to the treatment or factor being studied. It measures the deviation of each group mean from the overall mean.

c) SSE (Error Sum of Squares) represents the residual or unexplained variation in the data. It measures the deviation of each individual data point from its respective group mean.

d) The true statement is: SST = SSTr + SSE. This equation states that the total variation (SST) is equal to the sum of the variation attributed to the treatment (SSTr) and the residual or unexplained variation (SSE).

e) The average between-group variation is represented by MST (mean square treatment). MST is calculated by dividing the treatment sum of squares (SSTr) by the degrees of freedom associated with the treatment. It represents the average variation between the group means and provides information about the treatment effect or the differences between groups.

Learn more about variation on

https://brainly.com/question/6499629

#SPJ4

6=2(y+2) i need help

Answers

Answer:

y=1

Step-by-step explanation:

6=2(y+2)

6=2y+4

2=2y

y=1

Answer:

y=1

Step-by-step explanation:

A faraway planet is populated by creatures called Jolos. All Jolos are either
green or purple and either one-headed or two-headed.
Balan, who lives on this planet, does a survey and finds that her colony of 500
contains 100 green, one-headed Jolos: 125 purple, two-headed Jolos; and
270 one headed Jolos.

Answers

Answer:

Option B

Step-by-step explanation:

We have to complete the table given in the question,

                         One headed               Two headed                    Total

Green                      100                       230 - 125 = 105        105 + 100 = 205

Purple            270 - 100 = 170                    125                      170 + 125 = 295

Total                         270                      500 - 270 = 230                500

By analyzing the given table,

Number of green Jolos in Balan's colony = Total of one headed green Jolos and Two headed green Jolos

= 205

Therefore, number of green Jolos in Balan's colony are 205.

Option B will be answer.

Answer:

When you put together the whole chart you will see the total is 205.

Other Questions
Which moon phase is represented in the diagram below?* new first full waning crescent If you know the area and the base of a triangle, how can you find the height? 5th grade math. correct answer will be marked brainliest A random sample of n = 145 items are selected for measurement. Nothing is known about the distribution of measurements. Are the requirements for constricting a confidence interval for the population mean satisfied? None of these No It depends Not enough information No answer text provided. Yes I choose a card at random from a well-shuffled deck of 52 cards.The probability that the card chosen is a spade or a black cardis:a.37/52b.38/52c.39/52d.36/52 Which of the following is a major difference between stock and bond investments? a.Bonds can be issued by governments but stock cannot. b.Stocks have a fixed maturity but bonds do not c.it is possblet earn arent income on bonds but not on stock d.All of the choices are correct. 1.Mike buys an item with a price of $15 and uses a 10% off coupon. How much does he save by using this coupon? ways in which employment can minimize emotional stress Help me pls fasttttttt Question 5 Multiple Choice Worth 2 points) Which of the following conditions leads to hurricane season in the Atlantic region? O wind speeds in the Atlantic Ocean warm waters in the Atlantic Ocean O high pressure zones over the Atlantic Ocean O high wind speeds in the upper atmosphere above the Atlantic Ocean Find the sine, cosine, and tangent of acute angle A A thick steel slab ( 7800 kg/m3 , c 480 J/kg K, k 50 W/m K) is initially at 300 C and is cooled by water jets impinging on one of its surfaces. The temperature of the water is 25 C, and the jets maintain an extremely large, approximately uniform convection coefficient at the surface. Assuming that the surface is maintained at the temperature of the water throughout the cooling, how long will it take for the temperature to reach 50 C at a distance of 25 mm from the surface a strategic group is a group of firms in an industry that serving the same market segment. [see p.108] group of answer choices true fals Please give me the correct answers.Only answer if you're very good at English.Please don't put a link to a website.Complete the sentences to summarize this article.Some parents feel it's ___for their kids to work hard only to lose the chance to play a sport they love.Being on a team could also help their kids ___.On the other hand, some feel that competition is ___ because it drives kids to do their best.It also teaches them to ___.1st blank box: unfair, illegal,or helpful2nd blank box: become a coach, pay for college,or win in court3rd blank box: rewarding, wrong,or simple4th blank box: face lawsuits,skip tryouts,or handle failure. A culture of bacteria doubles every hour. If there are 500 bacteria at the beginning, how many bacteria will there be after 9 hours A. 256,000B.40,500C. 9,000D. 4,500(I NEED ANSWERED ASAP ) this my same question from the first one ) A rectangular cornfield has a length of 7 kilometers and an area of 63 square kilometers. What is the width of the cornfield? What will be the area if the length and width are doubled? Brieffy distinguish betweenquotationand Citation ABM Services paid a $4.15 annual dividend on a day it closed at a price of $54 per share. Whatwas the yield? A uniform circular disk of radius R = 44 cm has a hole cut out of it with radius r = 13 cm. The edge of the hole touches the center of the circular disk. The disk has uniform area density .Part (a) The vertical center of mass of the disk with hole will be located:Part (b) The horizontal center of mass of the disk with hole will be located:Part (c) Write a symbolic equation for the total mass of the disk with the hole.Part (d) Write an equation for the horizontal center of mass of the disk with the hole as measured from the center of the disk.Part (e) Calculate the numeric position of the center of mass of the disk with hole from the center of the disk in cm. How many capture/compare registers does the TB0 system have?Question 3 options:o1o3o4o7