Which temperatures originally represented the fixed points
Celsius temperature scale?

Answers

Answer 1

Answer:Since 1743 the Celsius scale has been based on 0 °C for the freezing point of water and 100 °C for the boiling point of water at 1 atm pressure. Prior to 1743 the values were reversed (i.e. the boiling point was 0 degrees and the freezing point was 100 degrees).

Explanation: i no it


Related Questions

What mass of carbon dioxide is produced from the complete combustion of 4.60x10^-3g of methane?

Answers

Answer:

Explanation:

CH4 + 2O2 ==> CO2 + 2H2O

mols CH4 = grams/molar mass

Using the coefficients in the balanced equation, convert mols CH4 to mols CO2.

Now convert mols CO2 to grams. g = mols x molar mass.

Determine the amount of grams present in 3.25x1024 atoms of Lithium.

Answers

When converted to a household measurement, 9 kilograms is approximately equal to a

What is the hydroxide concentration in a 0.20 M potassium acetate solution?

Answers

Answer:

Molar concentration of potassium hydroxide

= 0.27 Mol liter/approx

How many grams of potassium (K) contain 5.11 x 10^22 atoms of potassium?

Answers

The atomic mass of K is 39

from Avogadro's law

39g of K contains 6.02x10^23 atoms

therefore if

39=6.02x19^23

X=5.11×10^22

making X the subject of the formula

X= (5.11×10^22×39)÷6.02×10^23

X= 33g

The statement, that describes grams of potassium (K) contain 5.11 × [tex]10^{22}[/tex] atoms is "33.1 g."

What is an atom?

An atom is a fundamental particle of matter that contains at least one proton.

1 mole will be of 6.022 × [tex]10^{23}[/tex] atoms

Then,

[tex]= 5.11*10^{22} \;atoms\;.\;\frac{1\;mol}{6.022*10^{23} \;atoms} \;.\;39.098\;g/mol\\\\= 33.171\;g[/tex]

≈ 33.1 g

As a result, 33.1 g of K contains 5.11 × [tex]10^{22}[/tex] atoms.

Hence, the correct option is 33.1 g.

Learn more about atoms here

https://brainly.com/question/19922822.

#SPJ2

It’s a science question

Why can't more than one variable be changed during an experiment?

O You need to make sure your results match your hypothesis.
O Changing two or more variables makes it difficult to find a cause and effect relationship.
O Change two or more variables would take longer.
O Changing two or more variables would make the experiment more precise.

Answers

Answer:

Changing two or more variables makes it difficult to find a cause and effect relationship.

Tin has the atomic number Sn (Z = 50).
(a). Give its electronic structure
(b). Is it one of the transition metals?
(c). Knowing that it loses its electrons in pairs and that the 4d subshell is not affected. What are the possible degrees of oxidation for this element?

Answers

Tin has electron configuration [Kr] 5s²4d¹⁰5p² and it is not a transition element because its outermost orbitals are 5s² 5p². It has oxidation states of +2 and +4.

The electron configuration of tin is [Kr] 5s²4d¹⁰5p². The electronic structure of an atom shows the arrangement of electrons in the atom of an element. The electrons are arranged in sub-shells.

Tin is not a transition metal because it has a completely filled d sub-shell and  its outermost shell consists of ns, np orbitals.

Tin looses its electrons in pairs. Remember that the outermost orbitals are  5s² 5p². This means that tin can have two stable oxidation states, +2 and +4.

Learn more: https://brainly.com/question/10079361

Identify which of the following equations are balanced and which ones are not balanced

A. CH4 +202 —> CO2 + 2H20

B. 6CO2 + 6H2O—> C6H12O6+602

C. 2Na + H2O —> 2NaOH+ H2

Answers

Answer:

A. balancedB. UnblalancedC. Unbalanced

Explanation:

Give one example of a question that science could test. Then, explain in your own words why it is an example of a scientific question. Please!

Answers

Answer:

Questions are an essential part of science. ... They state the final question in a way that can be answered by investigation or experiment. A good scientific question is: “What effect does the pH of water have on radish seed germination?” Good scientific questions are defined, measurable, and controllable.

If 5.0g nitrogen dioxide completed reacted, how many grams of nitric acid would form?

Answers

Answer:

71847284737283774737373737

helppp! ill give brainliest

Answers

C & 4
Explanation: 1s2 2s2 2p6 3s2 3p2

Protons and neutrons have opposite, but equal magnitude, charges. An atom contains the same number of protons and electrons Neutrons and electrons are found in the nucleus of an atom. Protons have about the same mass as electrons. Electrons make up most of the mass of an atom. which one is true about subatomic particles

Answers

Answer:

the true statement is an atom contains the same number of electron and proton

Explanation:

let us see the behaviour of the sub atomic particles

nutrons and protons found in the nucleus of an atoman atom have the same number of electron and proton but they have different chargenutron is chargeless particlemost mass of the atom concentrated in the nucleus of an atomelectrons have almost 0 mass from an atommass of proton and mass of nutron are equvalent or almost equal

there are many properties of subatomic particles i have listed some of them above .

I think it is help ful for you

Why is mining for coal a long-term concern?

A. It is being replenished faster than it can be mined.
B. The supply will eventually be exhausted.
C. New methods of mining need to be developed.
D. The demand for coal is diminishing.

Answers

Answer: Is B: the supply will eventually be exhausted.

Explanation:

there is only so much coal in the world as in many other elements. That is why we are looking for more appropriate and resourceful way of supplying energy and it is a lot safer for the workers involved

As coal is a nonrenewable source of energy so its supply will eventually be exhausted. Therefore, option (B) is correct.

What are nonrenewable sources of energy?

Non-renewable energy can be described as energy that comes from fossil fuels such as coal, natural gas, crude oil, and uranium. Non-renewable energy requires human intervention to create it suitable for consumption. Fossil fuels are generally made up of Carbon. Fossil fuels were produced over 300 million years ago.

Non-renewable energy is generally fossil fuels such as coal, oil, natural gas, etc. Fossil Fuels are produced from the remains of animals and plants and can be is divided into three categories.

To produce natural gas from fossil fuels, the decomposition process is longer and conducted with high amounts of pressure and heat. Coal takes millions of years under the crust of the earth to produce through the decomposition of trees, plants, and ferns.

Learn more about nonrenewable sources of energy, here:

https://brainly.com/question/10402348

#SPJ2

During autumn, days grow colder. What happens to the nights?
They grow brighter.
They grow shorter.
They grow warmer.
They grow longer.

Answers

Answer:

I thinks its they grow longer explaination: I have a massive brain

Answer:

Brighter

Explanation:

adjoa's gross salary for last month was ghs 4687.24. if ghs 421.78 was deducted from adjoa's salary pay,how much take home pay did adjoa earned this past month?​

Answers

Since Ghs. 421.78 was deducted from Adjoa's salary pay, her take home pay is Ghs. 4265.46.

Given the following data:

Adjoa's gross salary = Ghs. 4687.24.Deduction = Ghs. 421.78

Gross profit can be defined as the profit earned by a business after subtracting its cost of manufacturing and distributing goods from its total revenue (sales).

On a related note, gross salary is the amount of money earned by an individual before any deduction such as tax.

To find how much take home pay Adjoa earned this past month:

[tex]Take\;home = Gross\;salary - deduction\\\\Take\;home = 4687.24 - 421.78[/tex]

Take home = Ghs. 4265.46.

Read more: https://brainly.com/question/25273589

Determine whether the bonds in CCl4 and N2 are polar or non-polar. If the bond is polar, assign the partial positive and negative charges. Electronegativity values: C = 2.5, Cl= 3.0, N= 3.0

Answers

Refer to the attachment

According to the molecular geometry, bonds in carbon tetrachloride are polar and that in nitrogen are non polar.

What is molecular geometry?

Molecular geometry can be defined as a three -dimensional arrangement of atoms which constitute the molecule.It includes parameters like bond length,bond angle and torsional angles.

It influences many properties of molecules like reactivity,polarity color,magnetism .The molecular geometry can be determined by various spectroscopic methods and diffraction methods , some of which are infrared,microwave and Raman spectroscopy.

They provide information about geometry by taking into considerations the vibrational and rotational absorbance of a substance.Neutron and electron diffraction techniques provide information about the distance between nuclei and electron density.

Learn more about molecular geometry,here:

https://brainly.com/question/7558603

#SPJ2

helpppppppppppppppppppppppppp

Answers

Answer:

B

Explanation:

Answer:

B

Explanation:

U can read the second part

How would you make the following compounds from N-benzylbenzamide?
a)dibenzylamine
b)benzoic acid
c)benzyl alcohol

Answers

Answer:

B.

Explanation:

What is a small description of a molecule

Answers

Answer:

molecule, a group of two or more atoms that form the smallest identifiable unit into which a pure substance can be divided and still retain the composition and chemical properties of that substance.

WILL MARK BRAINLY

Under what conditions will a low temperature make a reaction spontaneous?
O A. If AH and AS are both positive
O B. If AH and AS are both negative
O c. If a catalyst is used in the reaction
O D. If the reaction is endothermic

Answers

Answer:

B

Explanation:

If AH and AS are both negative  will a low temperature make a reaction spontaneous.

What is Spontaneous reaction?

A spontaneous reaction is a reaction that favors the formation of products at the conditions under which the reaction is occurring. A roaring bonfire (see figure below) is an example of a spontaneous reaction.

A fire is exothermic, which means a decrease in the energy of the system as energy is released to the surroundings as heat.

The products of a fire are composed mostly of gases such as carbon dioxide and water vapor, so the entropy of the system increases during most combustion reactions.

Therefore,  If AH and AS are both negative  will a low temperature make a reaction spontaneous.

To learn more about Spontaneous reaction, refer to the link:

https://brainly.com/question/13790391

#SPJ2

.. How many seconds will it take for a satellite to travel 650 km at a rate of 220 m/s?

Answers

Answer: 3750s Happy To Help

Explanation:

What differences between snow and sand

Answers

Answer:

difference is the temperature at which they melt. Snow melts at 0°C, whereas sand melts at about 1600°C! The temperature at which something melts is its melting point.

Oxalic acid is a diprotic acid with a first dissociation constant Ka1 = 0.0537 and a second dissociation constant Ka2 = 5.42×10-5. Consider all the species in equilibrium with each other in a 0.45 M solution. Note that the first acid dissociation constant is pretty large. This acid is almost a strong acid.

Part 1:
What is the concentration of undissociated oxalic acid in the 0.45 M oxalic acid solution?

Part 2:
What is the concentration of hydrogen oxalate?

Part 3:
What is the concentration of oxalate?

Part 4:
What is the concentration of hydronium?

Part 5:
What is the concentration of hydroxide?

Part 6:
What is the pH of the solution?

Answers

Answer:

50 points for this easy question

helppppppppppppppppppppppppppp

Answers

the answer is true
correct me if i’m wrong :)

Answer:

It's also true

Explanation:

the answer is written in this question

I hope that helps

HELPPPPPP
Calculate the frequency of light with a wavelength 559nm​

Answers

Answer:

Refer to the attachment

List the steps in naming covalent compounds.

Answers

1.       Name the non-metal furthest to the left on the periodic table by its elemental name.

2.       Name the other non-metal by its elemental name and an -ide ending.

3.       Use the prefixes mono-, di-, tri-.... to indicate the number of that element in the molecule.

4.       If mono is the first prefix, it is understood and not written

Answer:

Rules for naming simple covalent compounds:

1.    Name the non-metal furthest to the left on the periodic table by its elemental name.

2.   Name the other non-metal by its elemental name and an -ide ending.

3.    Use the prefixes mono-, di-, tri-.... to indicate the number of that element in the molecule.

4.  If mono is the first prefix, it is understood and not written

Examples:

N2O4 is called dinitrogen monoxideCO2 is called carbon dioxideCO is called carbon monoxideN2O is called dinitrogen monoxide.  (It is also called nitrous oxide but that is another naming scheme.)CCl4 is called carbon tetrachloride

Here is a chart of those prefixes:

1 - mono

2 - di

3 - tri

4 - tetra

5 - penta

6 - hexa

7 - hepta

8 - octa

9 - nona

10 - deca

John Dalton thought that atoms


1. Cannot be broken down further
2. Have no mass
3. Contain molecules
4. Are all composed of carbon

Answers

Answer:

cannot be broken down further

60) Which of the following is a chemical property?
A) Sugar is a solid at room temperature.
B) Potassium reacts with water to form potassium hydroxide.
C) Sugar dissolves in water.
D) Gasoline and water do not mix.
.

Answers

Answer:

C is the answer. Sugar Dissolves in water

Explanation:

Brainliest Maybe

Sugar dissolves in water is a chemical property. Therefore, option C is correct.

What do you mean by chemical properties ?

Chemical properties describe a substance's characteristic ability to react to form new substances; they include flammability and corrosion susceptibility. A pure substance's chemical and physical properties are the same in all samples.

A chemical property is the ability or inability to change one type of matter into another. Chemical properties include flammability, toxicity, acidity, reactivity, and heat of combustion.

A chemical property explain the ability of a substance to undergo a specific chemical change. To verify a chemical property, we look for a chemical change.

Thus, Sugar dissolves in water is a chemical property, option C is correct.

To learn more about the chemical property, follow the link;

https://brainly.com/question/1935242

#SPJ2

HELP SOON PLEASE THIS IS DUE TONIGHT! I WILL GIVE BRAINLIEST!
In an experiment where you use wires, a 9 volt battery, and a light bulb; what would be the best conductor to put on the ends of the wires? Please rate the following solution/liquids and their brightness from 1-5

-Tap water
-Baking soda
-Vinegar
-Coca Cola (or any soda, I guess)

Answers

Answer:

I would say baking powder maybe or you should try tap water

Answer:

1st one - tap water (ill go over them one by one to help you understand why)

Its honestly rather vinegar or tap water but if I would go with tap water however I could be wrong. I don't take your class lol

Step by step:

First, tap water includes a lot of ions and contaminants. As a result, tap water only contains ions capable of conducting electricity. As a result, tap water is an excellent electrical conductor.

2nd) Ammonia and baking soda are both weak bases. When weak electrolytes dissolve in water, the resulting solution has a low conductivity.

Third, because it releases H+ and CH3COO- ions, the mobility of these ions in the solution assists in electrical conduction. As a result, vinegar is a good electrical conductor.

4th) When dissolved in water, soda compounds (chemicals mostly containing sodium) include ions, and ions assist conduct electricity. As a result, it does not conduct because it lacks ions or charged particles.

how many number of atoms are present in 0.55moles of calcium​

Answers

Explanation:

The warmer and less dense air near the ground rises during the day pulling more air through the valley floor. This gentle upslope wind known as a valley breeze. ... The cooler and denser air at higher elevations flows back down the slopes of the mountain and into the valley. This is called a mountain breeze.29-May-2017

https://www.weathernationtv.com › ...

Mountain and Valley Breezes - WeatherNation

Feedback

About featured snippets

Mountain breeze and valley breeze

Images

View all

Description

A mountain breeze and a valley breeze are two related, localized winds that occur one after the other on a daily cycle. They are not the same as anabatic and katabatic winds, which are larger and stronger. These winds are opposite from each other. Wikipedia

does exercise increase, decrease or have no effect on the amount of carbon dioxide you exhale ​

Answers

Answer:

It increases the amount you exhale

Explanation:

The more you exercise and make your body work, the more oxygen you inhale which causes you to let out more carbon dioxide than if you were just resting.

Other Questions
Determine whether the function is continuous or discontinuous. what is the geosphere, also called the lithosphere Read this excerpt from "We Wear the Mask" by Paul Laurence Dunbar and answer the question that follows:We wear the mask that grins and lies,It hides our cheeks and shades our eyes, This debt we pay to human guile;With torn and bleeding hearts we smile,And mouth with myriad subtleties.Why should the world be over-wise,In counting all our tears and sighs?Nay, let them only see us, whileWe wear the mask.We smile, but, O great Christ, our criesTo thee from tortured souls arise.We sing, but oh the clay is vileBeneath our feet, and long the mile;But let the world dream otherwise,We wear the mask!What effect does the poet achieve by repeating the phrase "We wear the mask" throughout the poem?Complete the sentence to answer the question.In the poem "We Wear the Mask," Paul Laurence Dunbar voices his repressed anger and frustration toward American society. He repeats the title phrase three times in the poem, using the words mask and we to show that every individual experiences some kind of alienation, though their experiences may differ.Reset NextAnalyzing Mood and Voice in Poetry: Mastery Test 2021 Edmentum. All rights reserved.Read this excerpt from "We Wear the Mask" by Paul Laurence Dunbar and answer the question that follows:We wear the mask that grins and lies,It hides our cheeks and shades our eyes, This debt we pay to human guile;With torn and bleeding hearts we smile,And mouth with myriad subtleties.Why should the world be over-wise,In counting all our tears and sighs?Nay, let them only see us, whileWe wear the mask.We smile, but, O great Christ, our criesTo thee from tortured souls arise.We sing, but oh the clay is vileBeneath our feet, and long the mile;But let the world dream otherwise,We wear the mask!What effect does the poet achieve by repeating the phrase "We wear the mask" throughout the poem?Complete the sentence to answer the question.In the poem "We Wear the Mask," Paul Laurence Dunbar voices his repressed anger and frustration toward American society. He repeats the title phrase three times in the poem, using the words mask and we to show that every individual experiences some kind of alienation, though their experiences may differ.Reset NextAnalyzing Mood and Voice in Poetry: Mastery Test 2021 Edmentum. All rights reserved. How do polar water molecules pass through the plasma membrane? (3 points)Water molecules pass through channel proteins to cross the membrane.Water molecules can pass through the membrane freely and rapidly.Water molecules dissolve into the lipid bilayer and cross the membrane.Water molecules attach to cholesterol and cross the membrane. draw a relation diagram for the function f:x= 2(3x-1) where x{1,2,3,4,5} can anyone help me with question b PLEASE HELP ME MAKE SURE THIS IS RIGHTDuring reflection, a writer ______ the significance of an eventA. Ignores B: EvaluatesC: ExperiencesD: Summarizes Anna: My lifes got stuck these days. I am so depressed and unable to think of anything.Bill: "________." A.You will be tired. B.Stay calm. Everything will be alright. C.Stay stuck there. D.No, thanks. Magbigay ng mga paraan kung paano mababawasan ang mgaepekto ng kalamidad. Each substance has a unique set of properties that depends on the kinds of atoms it has and how the atoms are connected, or bonded. Bonding is related to the electrons in an atom, and there are different kinds of bonds. As a result, some substances can have the same atoms but different bonds. Substances that are different but have the same atoms are called allotropes. Allotropes have very different properties.Diamond and graphite are well-known allotropes. Graphite is used in pencils for writing and is sometimes called lead. Diamond is colorless and transparent, and is one of the hardest substances known. Graphite is dark gray and soft. When we write, layers of graphite easily transfer from the pencil to the paper. Although theyre different, diamond and graphite each only contain one kind of atomcarbon.How do you think the bonds between carbon atoms might be different in diamond and graphite? Use household materials to build physical models to help you develop your ideas. Describe what you learned from your models. What other kinds of allotropes are there? What kinds of properties and atomic bonds do they have? How do division properties help you evaluate expressions?Drag a word or number to the box to correctly complete the statement.When the Response area of a fraction is equal to Response area, the value of the fraction is 0. People attended the State Fair at a rate of 42 people per minute. How many hours would it take for there to be 15,000 people at the Fair (first find how many minutes it will take)? What is the graph of the function f(x) = the quantity of x squared minus 7 x plus 12, all over x minus 3 ? (1 point); When workers use technology to work from home or an office center, they are?a. distributing workb. telecommutingc.outsourcingd socially changing classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2 A group of friends want to go to the amusement park. They have $137.75 to spend on parking and admission. Parking is $15.25, and tickets cost $24.50 per person including tax. Write and solve an equation which can be used to determine x, the number of people who can go to the amusement park. if i had 475 connolies and got left with 24 and i sold them for 2.50 how much money did i make. Which is a reason why ethics are important to a free market economy?A. They create fair competition among businessesB. They allow large businesses to control smaller businesses.C. They enable businesses to operate without any restrictions.D. They force businesses to operate for the benefit of the government Principal: 300Annual Rate: 3%Time: 4 YearsInterest Earned: ?????New Balance: ?????!!!!!SOMEONE PLEASE HELP ME FIGURE OUT INTEREST EARNED AND NEW BALANCE!!!! Peoples personal information is collected _____. Select 4 options.A. in order to learn how to enhance their privacy.B. so that organizations can make predictions about people.C. so that governments can make decisions about policing.D. so that organizations can market more effectively.E. in order to learn more about the way they behave.