Is area and volume inversely proportional?

Answers

Answer 1

Yes, the area and the volume are inversely proportional to each other.

Here we have to verify that the area and volume inversely proportional.

As we all know that in math, the term area is used for the 2 dimensional shapes where as the volume refers the 3 dimensional shapes.

Let us consider the example of square.

We all know that the area of square is a x a whereas the volume of square is a x a x a.

Here we have identified that the volume is one step ahead of the area and each of them are inversely proportional to each other.

To know more about Volume here.

https://brainly.com/question/11168779

#SPJ4


Related Questions

True or false math. Make sure you are correct though. Thank you!

Answers

Answer:

True

Step-by-step explanation:

Most of the function f(x) has the domain is (- infinity, positive infinity), So I think this is true!

In a survey of 118 randomly selected gun owners, it was found that 81 of them said they owned a gun primarily for protection.

Find the margin of error and 95% confidence interval for the percentage of all gun owners who would say that they own a gun primarily for protection. Report answers to at least 2 decimal places.

Margin of Error (as a percentage)

Answers

The margin of error is 0.086 and its C.I is (0.575 , 0.785).

What is margin of error?

Your results will vary from the actual population value by how many percentage points, as indicated by the margin of error. A 95% confidence interval with a 4% margin of error, for instance, indicates that your statistic will, 95% of the time, be within 4% of the true population figure.

n = 117 , x =87

Point estimate for the proportion:

P = x/n

= 81/118

= 0.68644

Confidence = 95%, α = 0.05

From z-table area 0.975 close to z=1.96

Margin of error, E = 1.96 √((0.68*0.55)/130)

= 1.96 * 0.05363

= 0.105

= 0.086

Confidence = P ± E

= 0.68 ± 0.105

=(0.68-0.105 , 0.68+0.105)

= (0.575 , 0.785)

Hence, the margin of error is 0.086 and its C.I is (0.575 , 0.785).

To know more about margin of error check the below link:

https://brainly.com/question/24289590

#SPJ1

Ridgid motions to prove

Answers

Answer:

Sequence:

1. [tex]T__{ < 0,-5 > } (ABCDE) = (A'B'C'D'E)[/tex]

. . . . . . . . . .  ⭐ please take a ruler and measure the distance from AA',    . . .  . . . . . BB', CC', DD', and EE', and then write that distance (it should      . . . . . . . .  be the same for each measurement) in place of 5 in -5. I just     . . . . . . . .  wrote -5 because it was my best approximation for looking at     . . . . . . . .  a laptop screen. ⭐

2. [tex]R__{(180,B')} (A'B'C'D'E) = (A''B''C''D''E'')[/tex]

3. [tex]r__{D''E''} (A''B''C''D''E'') = (A'''B'''C'''D'''E''')[/tex]

Step-by-step explanation:

1. [tex]T__{ < 0,-5 > } (ABCDE) = (A'B'C'D'E)[/tex] means that when you move figure ABCDE down by 5 units, it will map onto the image of A'B'C'D'E.

2. [tex]R__{(180,B')} (A'B'C'D'E) = (A''B''C''D''E'')[/tex] means that when you rotate figure A'B'C'D'E' 180 degrees counterclockwise about point B', said figure will map onto the image of A''B''C''D''E''.

3. [tex]r__{D''E''} (A''B''C''D''E'') = (A'''B'''C'''D'''E''')[/tex] means that when you reflect figure A''B''C''D''E'' across segment D''E'', said figure will map onto the image A'''B'''C'''D'''E'''.

What is the relation between area height and volume?

Answers

The relation between area, height and volume is: volume = area * height

In this question we need to find the relation between area height and volume.

the formula for area and volume are based on height:

volume = base area * height

Let v represents the volume, A represents area and h represents the height.

V = A * h

As we know the volume of rectangular prism is:

volume = length * width * height

i.e., V = l * w * h

and the base area is:

area = length * width

i.e., A = l * w

Substitute A =  l * w in V = l * w * h

Then we get, V = A * h

Therefore, the relation between area, height and volume is: V = A * h i.e., volume = area * height

Learn more about the area, height and volume here:

https://brainly.com/question/19217739

#SPJ4

Calculate the approximate degree measure of the angle, given the following expression: cos(y°) = -0.10 Round your answer to the nearest tenth.​

Answers

Answer:

y ≈ 95.7°

Step-by-step explanation:

To solve for the angle a trigonometric function is being used on, we have to use the inverse of the trigonometric function.

Inverse of tan(y°) = 4.12:

[tex]tan^{-1}(-0.10) = y[/tex]

Next, I used a scientific calculator to find the angle measure of y. I recommend using the Desmos Scientific Calculator.

[tex]95.7 = y[/tex]

How do you solve for x and y values?

Answers

Solving for two variables (normally denoted as "x" and "y") requires two sets of equations.

Assuming you have two equations, the best way for solving for both variables is to use the substitution method, which involves solving for one variable as far as possible, then plugging it back in to the other equation. Knowing how to solve a system of equations with two variables is important for several areas, including trying to find the coordinate for points on a graph.

Write out the two equations that have the two variables you want to solve. For this example, we will find the value for "x" and "y" in the two equations "3x + y = 2" and "x + 5y = 20"

Solve for one of the variables in on one of the equations. For this example, let's solve for "y" in the first equation. Subtract 3x from each side to get "y = 2 - 3x"

Plug in the y value found from the first equation in to the second equation in order to find the x value. In the previous example, this means the second equation becomes "x + 5(2- 3x) = 20"

Solve for x. The example equation becomes "x + 10 - 15x = 20," which is then "-14 x + 10 = 20." Subtract 10 from each side, divide by 14 and you have end up with x = -10/14, which simplifies to x = -5/7.

Plug in the x value in to the first equation to find out the y value. y = 2 - 3(-5/7) becomes 2 + 15/7, which is 29/7.

Check your work by plugging in the x and y values in to both of the equations.

To know more about variables visit brainly.com/question/17344045

#SPJ4

A model with 3 rows of 5 squares and 3 rows of 3 squares. Use the model to find the missing number in the pair of equivalent expressions. 15 + 9 = ?(5 + 3) what number is missing from the expression?.

Answers

The missing number in the pair of equivalent expressions is 9.

To solve this problem, you can use the model provided to represent the expressions 15 + 9 and 5 + 3.

For the expression 15 + 9, you can place 15 in the first row of five squares and 9 in the second row of five squares, like this:

[15] [9]

For the expression 5 + 3, you can place 5 in the first row of three squares and 3 in the second row of three squares, like this:

[5] [3]

Then, you can use the model to find the missing number in the pair of equivalent expressions. Since the two expressions are equivalent, the missing number should be in the same position as the number 3 in the second row of the model.

If you look at the first expression, you can see that the missing number is in the same position as the number 9. Therefore, the missing number in the pair of equivalent expressions is 9.

Learn more about the expressions at

https://brainly.com/question/14083225?referrer=searchResults

#SPJ4

dr. yung tests a new anti-malaria drug in an asian population and concludes that he cannot reject the null hypothesis, and must conclude he does not have sufficient evidence to conclude that the drug works. in reality, the drug does work. dr. yung has committed a error. group of answer choices logical type i (false positive) type ii (false negative) statistical

Answers

Dr. Yung has committed a type l ( false positive) error.

What is a type I error?

Rejecting a null hypothesis that is actually true in the population results in a type I error (false-positive); failing to reject a null hypothesis that is actually false in the population results in a type II error (false-negative).

A type I error occurs when a null hypothesis that is actually true is mistakenly rejected during statistical hypothesis testing (also known as a "false positive" finding or conclusion; example: "an innocent person is convicted"),

Therefore, the error is a type 1 error.

Learn more about type 1 error on:

https://brainly.com/question/28166129

#SPJ1

How many points lie on a line?

Answers

The number of points that lie on a line are innumerable.

Which is a discontinuous process?

Answers

The function of the graph which is not connected with each other is known as a discontinuous function. A function f(x) is said to have a discontinuity of the first kind at x = a, if the left-hand limit of f(x) and right-hand limit of f(x) both exist but are not equal.

The function is an expression or law that defines a relationship between one variable and the independent variable and another variable the dependent variable

The independent variable is the variable being controlled in the problem, and the dependent variable is the variable that changes because of this control

Some examples of a discontinuous function

f(x) = 1 / (x - 2)

f(x) = tan x

f(x) = x2 - 1

For x < 1 and f(x) = x3 - 5 for 1 < x < 2

To learn more about the Discontinuous Process visit:

brainly.com/question/28499702

#SPJ4

A relationship between one variable, the independent variable, and another variable, the dependent variable, is defined by an expression or law known as the function.

The variable being controlled in the problem is the independent variable, and the variable that changes as a result of this control is the dependent variable.

f(x) = 1 / (x - 2)

f(x) = tan x

f(x) = x2 - 1

For x < 1 and f(x) = x3 - 5 for 1 < x < 2

Harry's soccer team is trying to raise $2,520 to travel to a tournament in florida, so they decided to host a pancake breakfast. Each person must pay $15 for the breakfast. How many people need to attend their breakfast in order to raise $2520?.

Answers

Harry's soccer team needs 168 people to attend their pancake breakfast in order to raise $2,520.

To find the number of people that need to attend the pancake breakfast, we can set up the following equation:

Number of People x Cost per Person = Total Cost

We know that the total cost is $2,520 and the cost per person is $15, so we can substitute those values into the equation:

Number of People x $15 = $2,520

We can solve for the number of people by dividing both sides of the equation by $15:

Number of People = $2,520 / $15

This gives us the number of people that need to attend the pancake breakfast in order to raise the desired amount of money. In this case, the number of people is 168.

Therefore, Harry's soccer team needs 168 people to attend their pancake breakfast in order to raise $2,520.

To learn more about total cost, refer:-

https://brainly.com/question/28652728

#SPJ4

How do you solve the mean error?

Answers

ME adds up the variances and divides the result by n. In this context, an error is defined as an uncertainty in a measurement or the difference between the measured value and the true/correct value.

What is mean?

In mathematics and statistics, the mean is the average of a set of variables. The simple arithmetic mean (add the numbers and divide the total by the number of observations), geometric mean, and harmonic mean are all ways for calculating the mean. The mean (average) of a data set is computed by adding all of the numbers in the set and dividing by the number of values in the set. When arranging data from smallest to greatest, the median is the value in the middle. The mode is the most commonly occurring number in a data set.

Here,

Subtract each measurement from another.

Find the absolute value of each difference from Step 1.

Add up all of the values from Step 2.

Divide Step 3 by the number of measurements.

Mean Error (ME) is calculated by adding the variances and dividing the result by n. An error in this sense is an uncertainty in a measurement, or the discrepancy between the measured value and the true/correct value.

To know more about mean,

brainly.com/question/3116920

#SPJ4

Kadeem invests money in an account paying a simple interest of 8% per year. If no money will be added or removed from the investment, what should he multiply his current balance by to find his total balance in a year in one step?

Answers

To find the total balance in an account that earns a simple interest rate of 8% per year, we can use the formula A = P(1 + rt), where A is the total balance, P is the initial principal (or amount invested), r is the annual interest rate, and t is the number of years. In this case, the annual interest rate is 8%, so we can substitute 0.08 for r in the formula. Since Kadeem wants to find his total balance in one step, we can set t equal to 1 year. So, to find Kadeem's total balance in one year in one step, he needs to multiply his current balance by 1 + 0.08 = 1.08. Therefore, Kadeem should multiply his current balance by 1.08 to find his total balance in a year in one step.

Samuel is folding his laundry. The table shows the proportional relationship between the number of shirts he folds and the time, in minutes, it takes him to fold them.


Number of Shirts 3 9 ?
Time (minutes) 0.5 1.5 5


How many shirts can Samuel fold in 5 minutes?
12 shirts
15 shirts
20 shirts
30 shirts

Answers

Answer:

30 shirts

Step-by-step explanation:

What we know:

30 seconds = 3 shirts

1 minute 30 seconds = 9 shirts

30 seconds per each 3 shirts

shirts:      3, 6, 9, 12, 15, 18, 21, 24, 27, 30

minutes: .5, 1, 1.5, 2, 2.5, 3, 3.5, 4, 4.5, 5

Answer:

30 shirts

Step-by-step explanation:

what distance has a cheats gone if it travels 25 m/s in 3 seconds

Answers

Answer:

75 m

Step-by-step explanation:

three seconds of 25 m/s and 3 x 25 = 75

5 dogs had long hair out of the 8 dogs at the park. What percent of the dogs had long hair? Round your answer to the nearest whole percent.

Answers

Answer:

62.5%

Step-by-step explanation:

5/8 × 100

should give you 62.6%

Can a 7th grader take algebra?

Answers

Yes, a 7th grader may be taken algebra. Depending on the school district, and capacity some 7th graders may be able to take algebra as an elective or as part of their regular curriculum.

Algebra is the branch of mathematics that helps in the rendering of problems or situations in the form of mathematical expressions.

It includes variables like x, y, z, and mathematical operations like addition, subtraction, multiplication, and division to form a meaningful mathematical expression.

Some of the branches of mathematics such as trigonometry, calculus, coordinate geometry, involve the use of algebra. One example is in algebra is 2x + 4 = 8.

To know more about Algebra:

https://brainly.com/question/24875240

#SPJ4

Solve for x: 7x-22=3x+18

Answers

Answer:

x = 10

Step-by-step explanation:

7x-22=3x+18

4x -22 = 18

4x = 40

x = 10

The answer is x=10 Yw

How do you store 3 values in one variable in Python?

Answers

My_3_variables = [title, author, date] and then put this list at the first position of your other list : my_list[0] = my_3_variables .

Now, According to the question:

Create a list containing your 3 variables : my_3_variables = [title, author, date] and then put this list at the first position of your other list : my_list[0] = my_3_variables .

How do I store multiple values in one variable Python?

append()

We use the append() method for this. You can use this to append single values to the list – value, list, tuple.

Learn more about Variable in Python at:

https://brainly.com/question/13437928

#SPJ4

How do you solve for the mean variance and standard deviation of the sampling distribution of sample means?

Answers

From the provided sample, The mean variance and standard deviation of the sample is given by [tex]\bar x = \frac{\sum x}{n} , variance = {standard deviation }^2[/tex] and

[tex]\sqrt \frac{\sum {(x-\bar x)^2}}{n-1}[/tex] .

What do you mean by sample?

Sampling is the process of choosing a portion of a statistical population to estimate attributes of the entire population in statistics, quality control, and survey methods. Statisticians try to get samples that are typical of the population under consideration.

What is mean and standard deviation?

The arithmetic mean, also known as the arithmetic average or simply the mean or average, is the sum of a set of numbers divided by the total number of numbers in the set. The collection frequently consists of a series of findings from a survey, experiment, or observational study.

The standard deviation is a statistic that expresses how much variance or dispersion there is in a group of numbers. While a high standard deviation suggests that the values are dispersed throughout a wider range, a low standard deviation suggests that the values tend to be close to the established mean.

sample size =n .

[tex]\sum x[/tex] = sum of sample data.

[tex]\bar x = \frac {\sum x}{n}[/tex] (sample mean)

sample standard deviation(s) = [tex]\sqrt \frac{\sum {(x-\bar x)^2}}{n-1}[/tex]

[tex]variance = standard deviation ^2[/tex]

To learn more about sampling visit:

https://brainly.com/question/14893265

#SPJ4

Find the missing measures in the parallelogram given below. Also, state the property used.

Answers

Answer:

see explanation

Step-by-step explanation:

AD = BC = 8 ( opposite sides of a parallelogram are congruent )

DC = AB = 15 ( opposite sides of a parallelogram are congruent )

Consecutive angles in a parallelogram are supplementary , sum to 180° , so

∠ A + ∠ D  = 180° , that is

∠ A + 68° = 180° ( subtract 68° from both sides )

∠ A = 112°

the opposite angles of a parallelogram are congruent , then

∠ B = ∠ D = 68° , and

∠ C = ∠ A = 112°

What are the 3 lengths of a right triangle?

Answers

A, B, C form a right triangle

What is a real value of x?

Answers

Answer:

X is a variable, the value depends on the equation

How do you describe the relationship of the volume between the volume of a sphere and the volume of a cylinder?

Answers

The relationship between the volume of a sphere and the volume of a cylinder is: the volume of a sphere is 2/3 of the volume of a cylinder with same radius, and height equal to the diameter.

In this question we need to describe the relationship of the volume between the volume of a sphere and the volume of a cylinder.

Consider  a cylinder with radius r and height h.

we know that the formula for the volume of cylinder is,

V1 = π * r² * h

Consider a sphere with radius r1.

We know that the formula for the volume of sphere is,

V2 = 4/3 * π * r1³

If the sphere and a cylinder have same radii and height of cylinder equal to the diameter then, r1 = r and h = 2r

V2 = 4/3 * π * r³

And V1 = π * r² * (2r)

V1 = 2 * π * r³

V1 = 2 * 3/4 * V2

V1 = 3/2 * V2

volume of cylinder = 3/2 *  volume of sphere

Therefore, the volume of a sphere = 2/3 * the volume of a cylinder

Learn more about the volume of a cylinder here:

https://brainly.com/question/16134180

#SPJ4

Write the number 1. 8 in the form , using integers, to show that it is a rational number.

Answers

The number 1. 8 in the form a / b, using integers, to show that it is a rational number is 9 / 5 .

Note that the number 1.8 consists of two parts 1 and 0.8.

The decimal 0.8 can be written as the fraction is 8 / 10

Add these two numbers :

= 1 + 8 / 10

multiply and divide by 10

= 10 / 10 + 8 / 10

= 10 + 8 / 10

= 18 / 10

simplify the number

= 2 * 3 * 3 / 2 * 5

= 1 * 3 * 3 / 1 * 5

= 9 / 5

Learn more about the rational number here:

https://brainly.com/question/24398433

#SPJ4

Function c is defined by the equation c(n) = 50 + 4n. It gives the monthly cost, in dollars, of visiting a gym as a function of the number of visits, n.

Complete each of the 2 activities for this Task.
Activity 1 of 2
Find the value of c(7).

Answers

In the equation c(n) = 50+4n, the value of c(7) is equal to 78.

What is a function?

Absolutely one element of Y is assigned to every element of X in a mathematical function from a set X to a set Y. Both the set X and the set Y are referred to as the function's domain and codomain, respectively.

Al-Biruni and Sharaf al-Din al-Tusi were two Persian mathematicians who developed the earliest known approach to function and its concept. The basic conception of functions was the relationship between fluctuating quantities and other variables. An illustration of this is how time affects a planet's position. In the past, the idea was developed with the infinitesimal calculus around the end of the 17th century, and, until the 19th century, the functions that were considered were differentiable.

This is how the function is defined:

The equation c(n) = 50+4n defines function c, and n is the number of visits.

The function displays the cost in USD per month.

Thus, the following formula can be used to get the value of c(7):

c(7) = 50+4n

c(7) = 50+4(7)

= 50+28

=78

Therefore, c(7)=78

So, the value of c(7)=78.

To know more about function, visit:

https://brainly.com/question/28278699

#SPJ1

is an integer.
Given that the value of lies between between 29 and 39 Write down the value of .

Answers

The values of the integers lie between 29 and 39 and is 30,31,32,33,34,35,36,37,38.

What is a number system?

A numeral system is a writing system for expressing numbers; that is, a mathematical notation for representing numbers of a given set in a consistent manner using digits or other symbols. In different numeral systems, the same sequence of symbols can represent different numbers.

A zero, a positive natural number, or a negative integer with a minus sign is an integer. The negative numbers are the additive inverses of their positive counterparts.

Given that the integers lie between the numbers 29 and 39. The numbers will be,

29, { 30,31,32,33,34,35,36,37,38 }, 39

Therefore, the values of the integers lie between 29 and 39 and are 30,31,32,33,34,35,36,37,38.

To know more about the number system follow

https://brainly.com/question/28550938

#SPJ1

Use the quadratic formula to solve x^2+3x-28=0

Answers

The solutions to the quadratic equation x² + 3x - 28 = 0 are 4 and -7.

What are the solutions to the quadratic equation?

The quadratic formula is expressed as;

x = (-b±√(b² - 4ac)) / (2a)

Given the equation;

x² + 3x - 28 = 0

a = 1b = 3c = -28

Substitute the values of a, b, and c into the formula and solve for x.

x = (-b±√(b² - 4ac)) / (2a)

x = ( -3 ±√( 3² -  ( 4 × 1 × -28) )) / (2×1)

x = ( -3 ±√( 9 -  ( -112) )) / (2)

x = ( -3 ±√( 9 + 112 )) / (2)

x = ( -3 ±√( 121 )) / 2

x = ( -3 ± 11 ) / 2

x = ( -3 - 11 ) / 2, x = ( -3 + 11 ) / 2

x = -14/2, x = 8/2

x = -7, x = 4.

Therefore, -7 and 4 are the solutions to the equation.

Learn more about quadratic formula here: https://brainly.com/question/4038687

#SPJ1

8. The speed of an object can be found by taking the distance it travels and dividing it by the
time it takes to travel that distance. An object travels 100 feet in 2.5 seconds Let the speed, be
measured in fleet per second. Write an equation to represent the relationship between the three
quantities (speed, distance, and time).

Answers

Speed of object = 40 feet per second

What is speed and its formula?Speed is calculated as follows: speed = distance * time. Knowing the units for distance and time is necessary to calculate the units for speed. The units will be in metres per second (m/s) in this example since the distance is measured in metres (m) and the time is measured in seconds (s).Speed is what it means. the speed at which an object's location changes in any direction. The distance travelled in relation to the time it took to travel that distance is how speed is defined. Since speed simply has a direction and no magnitude, it is a scalar number.Based on the distance travelled in a certain amount of time. These automobiles can travel at speeds of more than 150 kilometres per hour (km/h). Meters per second (m/s) is the fundamental unit of speed in the metric system.

Given data :

Distance cover by object = 100 feetTime taken by object = 2.5 seconds

Equation represent speed is s = d/t

Assume;

Speed = S

Time taken = T

Distance cover = D

So,

Speed = Distance / Time

S = D / T

Speed of object = 100 / 2.5

Speed of object = 40 feet per second

Learn more about speed refer to :

https://brainly.com/question/24739297

#SPJ1

The sophomore class needs a combined total of 216 medium and large t-shirts for field day. The number of medium t-shirts needed is three times the number of large t-shirts needed. Based on this information, would it be reasonable for the sophomore class to order 72 large t-shirts and 144 medium t-shirts?.

Answers

No it is not reasonable , because the number of medium T-shirts is not 3 times the number of large T-shirts .

Given :

Let say that the class need x medium and y large t - shirts .

so ,

x + y = 216

x = 3y

substitute

3y + y = 216

4y = 216

divide by 4 on both sides

4y / 4 = 216 / 4

y = 216/4

y = 54

x = 54 * 3

= 162

so here we need 162 medium t - shirts and 54 large t - shirts

given 72 large and 144 medium t - shirts so it not reasonable .

Learn more about the number here:

https://brainly.com/question/17429689

#SPJ4

Other Questions
A certain math test has a mean of 50 and a standard deviation of 12. the teacher wants to convert the scores to a new scale using the transformation x*=65+0.6x. what are the new mean and standard deviation?a) mean=50, standard deviation=7.2b) mean=95, standard deviation=7.2c) mean=95, standard deviation=12d) mean=95, standard deviation=72.2e) mean=77, standard deviation=12 What are the 3 phases of compliance? pls help me i will mark brainliest:)Simplify 5g(3g + 4).15g + 415g 20g15g2 + 415g2 20g Solve |2x - 2 6.A. x-2 or x 4B. x 3 or x 5C. x -2 or x 5D. x -2 or x 6 What does associative property look like? Why was the Scientific Revolution so impactful? Predict what happens to the mechanical advantage of a machine if friction is reduced through the use of oil or some other means. How did the literature of the northern renaissance reflect a movement towards secularism. Ellen riley is a district general manager who has been contacted by the local newspaper and tv stations about the recent identity thefts that occurred at some competitor locations in town. the reporters are looking for information on what steps Electronic rack-and-pinion systems use an electric motor to pump the hydraulic fluid through the hoses.a. trueb. false For each set of numbers find the mean (average).6, 12, 10, 8 Polyvinyl chloride (PVC) is one of the most commercially important polymers. PVC is made by addition polymerization of vinyl chloride ( C2H3Cl ). Vinyl chloride is synthesized from ethylene ( C2H4 ) in a two-step process involving the following equilibria:Equilibrium 1: C2H4(g)+Cl2(g)C2H4Cl2(g) Equilibrium 2: C2H4Cl2(g)C2H3Cl(g)+HCl(g)Use bond energies to estimate the enthalpy change, rH for Equilibrium 1.Polyvinyl chloride (PVC) is one of the most commercially important polymers. PVC is made by addition polymerization of vinyl chloride ( C2H3Cl ). Vinyl chloride is synthesized from ethylene ( C2H4 ) in a two-step process involving the following equilibria:Equilibrium 1: C2H4(g)+Cl2(g)C2H4Cl2(g) Equilibrium 2: C2H4Cl2(g)C2H3Cl(g)+HCl(g) Part BUse bond energies to estimate the enthalpy change, rH for Equilibrium 1.Part CUse bond energies to estimate the enthalpy change, rH , for Equilibrium 2. What additional information is needed to show that ABC DEF by SSS? the set of efficient points is best described as a.only area i: points inside the ppf. b.area i: inside the ppf and points on the ppf. c.area o: outside the ppf and points on the ppf. d.only area o: points outside the production possibilities frontier (ppf). e.only points on the ppf What is 3 5 equivalent to as a fraction? In triangle ABC acute angles are in the ratio 5:1, i.e. The SQL command that lets you select attributes from rows in one or more tables or views is ____.a. INSERTb. SELECTc. COMMITd. UPDATE help multipylook at the picture What makes similar shapes similar? A cuboid has a lateral surface of 260 cm and a height of 10 cm. The dimensions of the base are: one is 3 cm smaller than the other. Instruction: First, we find the perimeter of the base of the cuboid as a ratio of the side surface to the height. (260cm2: 10cm=26 cm.) Then we write the equation x+x-3+x+x-3=26cm, where with x we marked one of the sides, we find the sides