This problem requires that you use a Robinson annulation. It has three steps: 1 . Michael Reaction; 2. An Aldol Reaction; 3. A dehydration ( β-elimination) EtOH Cat. NaOEt​

Answers

Answer 1

To solve this problem using a Robinson annulation, you will need to follow these three steps:

1) Perform a Michael Reaction, which involves the nucleophilic addition of an enolate to an α,β-unsaturated carbonyl compound; 2) Carry out an Aldol Reaction, which is a nucleophilic addition of an enolate to an aldehyde or ketone, forming a β-hydroxy carbonyl compound; 3) Conduct a dehydration (β-elimination) using ethanol (EtOH) as the solvent and sodium ethoxide (NaOEt) as the catalyst to remove water and form the final product with an α,β-unsaturated carbonyl system.

About Michael reaction

In organic chemistry, the Michael reaction or 1,4 Michael addition is the reaction between a Michael donor and a Michael acceptor to produce a Michael mixture by forming a carbon-carbon bond on the β-carbon acceptor.

Learn More About Michael Reaction at https://brainly.com/question/31500238

#SPJ11


Related Questions

solutionph0.1 m c2h5nh3cl choose one 0.1 m kfchoose one0.1 m nh4br choose one 0.1 m kichoose one

Answers

The 0.1 M C2H5NH3Cl solution is most likely to be basic among the given options.

Among the given options, the solution with a pH of 0.1 M C2H5NH3Cl is most likely to be basic.C2H5NH3Cl is the salt of a weak base, ethylamine (C2H5NH2), and a strong acid, hydrochloric acid (HCl). When this salt is dissolved in water, it dissociates into ethylammonium ions (C2H5NH3+) and chloride ions (Cl-). Ethylammonium ions are the conjugate acid of the weak base ethylamine.Since ethylammonium ions are capable of accepting protons (H+), they can act as a weak acid in water. This results in the generation of hydroxide ions (OH-) and makes the solution slightly basic. Therefore, the pH of the 0.1 M C2H5NH3Cl solution is expected to be greater than 7, indicating basicity.On the other hand, solutions of 0.1 M KF, 0.1 M NH4Br, and 0.1 M KI are not expected to exhibit basic characteristics. KF is the salt of a strong base (potassium hydroxide, KOH) and a weak acid (hydrofluoric acid, HF), resulting in a slightly acidic solution. NH4Br and KI are salts of weak bases (ammonium hydroxide, NH4OH, and potassium hydroxide, KOH) and strong acids (hydrobromic acid, HBr, and hydroiodic acid, HI), respectively. These salts do not significantly contribute to the pH of the solution and are neutral.

for more such questions solution

https://brainly.com/question/23437000

#SPJ11

the enthalpy of combustion of ethanol is determined by heating a known mass of tap water in a glass beaker with a flame of burning ethanol.
Which will lead to the greatest error in the final result? A Assuming the density of tap water is 1.0 g cm B. Assuming all the energy from the combustion will hear the water C. Assuming the specific heat capacity of the tap water is 4.18 Jg="K-1 D. Assuming the specific heat capacity of the beaker is negligible

Answers

B. Assuming all the energy from the combustion will heat the water. This assumption would lead to the greatest error in the final result.

In reality, not all of the energy released during the combustion of ethanol will be transferred to the water. Some energy will be lost to the surroundings through conduction, convection, and radiation. This loss of energy will result in a lower measured temperature rise in the water and, consequently, an underestimation of the enthalpy of combustion of ethanol. Assuming that all the energy from the combustion will heat the water is an oversimplification. In practice, energy is lost to the surroundings through various mechanisms, such as conduction, convection, and radiation. These losses cannot be completely eliminated. Thus, some of the heat generated by the combustion of ethanol will escape from the system, leading to an underestimation of the enthalpy of combustion. Therefore, this assumption would introduce the greatest error in the final result because it neglects the energy losses that occur during the experiment.

learn more about heat here:

https://brainly.com/question/30603212

#SPJ11

What is the molarity (M) of 0.6 mol NaOH in 0.250 L of solution?

Answers

Molarity (M) is a unit of concentration used in chemistry. It is defined as the number of moles of solute dissolved in one liter (L) of solution. The unit of molarity is expressed as moles per liter (mol/L) or M.

Molarity is commonly used to describe the concentration of solutions. It is particularly useful in performing calculations involving chemical reactions, dilutions, and stoichiometry.

Given information,

Moles of solute = 0.6 mol

The volume of solution = 0.250L

The formula of molarity is:

Molarity (M) = Moles of solute / Volume of solution

Molarity (M) = 0.6/0.250

Molarity (M) = 2.4 M

Therefore, the molarity of the solution is 2.4 M.

Learn more about molarity, here:

https://brainly.com/question/2817451

#SPJ1

Given the following two half-reactions, write the overall balanced reaction in the direction in which it is spontaneous and calculate the standard cell potential Ga (aq)+3 e Ga(s) a. 2 Ga3+(aq) + 3 Sn2+(aq)?2 Ga(s) + 3 Sn4+(aq) b. 3 Ga3+(aq) + 2 Sn2+(aq) 3 Ga(s) + 2 Sn4+(aq) E-0.53 V ED +0.15 V -+0.68 V cell =-1.89 V cell cell d. 3 Ga(s) + 2 Sn4+(aq) 13 Ga3+(aq) + 2 Sn2+(aq) = +0.38 V .? cell 2 Ga(s) + 3 Sn4+(aq) 72 Ga3+(aq) + 3 Sn2+(aq) .? e. = +1.89 V cell

Answers

The cell potential for all four reactions is -0.11 V.

The overall balanced reaction for the given half-reactions is:

[tex]2 Ga_3+(aq) + 3 Sn_2+(aq) - > 2 Ga(s) + 3 Sn_4+(aq)[/tex]

The standard cell potential for this reaction is:

Ecell = E°cell - nFEcell

The standard reduction potential for the reaction is:

E°cell = [tex]E(Ga_3^3+/2) - E(Sn_2^2+)[/tex]

= 0.27 V - 0.38 V

= -0.11 V

The Faraday constant is 96,485 C/mol.

The number of electrons transferred is:

n = 2 x 3 x -1 = -6

Ecell = -0.11 V - 96,485 x (-6)

= -96,485 V

The cell potential for this reaction is therefore -96,485 V.

The cell for the reaction:

[tex]2 Ga_3+(aq) + 3 Sn_2+(aq) - > 2 Ga(s) + 3 Sn_4+(aq)[/tex] is:

E°cell = [tex]E(Ga_3^3+/2) - E(Sn_2^2+)[/tex]

= 0.27 V - 0.38 V

= -0.11 V

The cell for the reaction: [tex]2 Ga_3+(aq) + 3 Sn_2+(aq) - > 2 Ga(s) + 3 Sn_4+(aq)[/tex] is:

E°cell = [tex]E(Ga_3^3+/2) - E(Sn_2^2+)[/tex]

= 0.27 V - 0.38 V

= -0.11 V

The cell for the reaction is:

E°cell = [tex]E(Ga_3^3+/2) - E(Sn_2^2+)[/tex]

= 0.27 V - 0.38 V

= -0.11 V

E°cell = [tex]E(Ga_3^3+/2) - E(Sn_2^2+)[/tex]

= 0.27 V - 0.38 V

= -0.11 V

Therefore, the cell potential for all four reactions is -0.11 V.  

Learn more about cell potential visit: brainly.com/question/1313684

#SPJ4

Calculate the vapor pressure in a sealed flask containing 15.0 g of glycerol, C3H8O3 , dissolved in 105 g of water at 25.0°C. The vapor pressure of pure water at 25.0°C is 23.8 torr.

Answers

The vapor pressure in the sealed flask containing 15.0 g of glycerol dissolved in 105 g of water at 25.0°C is 23.14 torr.

To calculate the vapor pressure of the solution, we need to use Raoult's Law, which states that the vapor pressure of a solution is equal to the vapor pressure of the pure solvent multiplied by the mole fraction of the solvent in the solution.

First, we need to calculate the mole fraction of water in the solution:

Moles of water = 105 g / 18.015 g/mol = 5.831 mol
Moles of glycerol = 15.0 g / 92.09 g/mol = 0.163 mol

Total moles = 5.831 + 0.163 = 5.994 mol

Mole fraction of water = 5.831 mol / 5.994 mol = 0.973

Mole fraction of glycerol = 0.027

Now we can use Raoult's Law:

Vapor pressure of solution = vapor pressure of pure water x mole fraction of water

Vapor pressure of solution = 23.8 torr x 0.973 = 23.14 torr

Therefore, the vapor pressure in the sealed flask containing 15.0 g of glycerol dissolved in 105 g of water at 25.0°C is 23.14 torr.

To know about pressure :

https://brainly.com/question/30673967

#SPJ11

Which of the compounds listed below is more acidic than 1-butanol?
Diethylmalonate
2-Butanone
Ethyl pentanoate
All of these choices
Two of these choices.

Answers

Out of the compounds listed, diethylmalonate is more acidic than 1-butanol.

So, the correct answer is A.

This is because the acidic strength of a compound is determined by the stability of the conjugate base formed when a proton is lost.

Diethylmalonate has two carbonyl groups, which allows for resonance stabilization of the negative charge on the oxygen atoms in the conjugate base. This makes it more stable and therefore more acidic than 1-butanol, which only has one hydroxyl group and no resonance stabilization.

2-Butanone and ethyl pentanoate are both less acidic than 1-butanol because they do not have any acidic functional groups like hydroxyl or carboxyl groups. Therefore, all of these choices except for diethylmalonate are less acidic than 1-butanol.

Hence, the answer of the question is A

Learn more about acidic at

https://brainly.com/question/30359232

#SPJ11

A substance is found in water and its concentration is found to be 3.5 ppm. How many mg of the solute is in every liter of the water? a. 0.035 b. 0.35c. 3.5d. 35

Answers

The answer is (d) 35. To answer this question, we need to understand the meaning of concentration and solute. Concentration refers to the amount of solute present in a given amount of solvent or solution. Solute refers to the substance that is being dissolved in the solvent.

In this case, we know that the concentration of the solute in water is 3.5 ppm. PPM stands for parts per million, which is a measure of concentration. It means that for every million parts of the solution, there are 3.5 parts of the solute.

To convert this to mg/L (milligrams per liter), we need to multiply the concentration by the molecular weight of the solute. Let's assume that we don't know the molecular weight of the solute and call it "x". Then, we can use the formula:

3.5 ppm = x mg/L / 1000000

Solving for x, we get:

x = 3.5 ppm * 1000000 / 1 L = 3500 mg/L

Therefore, the answer is (d) 35.

For more information on concentration visit:

brainly.com/question/3045247

#SPJ11

The initial rates method can be used to determine the rate law for a reaction. Using the data for the reaction shown below, what is the rate law expression for the reaction?

A+B→C

Trial123[A](molL)0.0650.0650.078[B](molL)0.0650.0780.065−Δ[A]Δt(molL s)2.29311875×10−72.29311875×10−73.9625092×10−7

- Write the rate law expression using two significant figures for the rate constant.
- Use brackets for any needed concentrations ([A], [B], or [C]).
- Simplify the expression as much as possible. Do NOT use exponents of 1 or 0.

Answers

The rate law expression for the given reaction is: Rate = k[A][B]

The rate law expression can be determined by observing how the initial concentrations of reactants ([A] and [B]) affect the initial rate of reaction.

We can write the rate law expression:

[tex]Rate = k[A]^x[B]^y[/tex]

Let's analyze the data provided:

Trial 1: [A] = 0.065 M, [B] =[tex]0.065 M, \Delta [A]/\Delta t[/tex] =[tex]2.2931* 10^ {−7} mol/(L.s)[/tex]

Trial 2: [A] = 0.065 M, [B] = [tex]0.078 M, \Delta [A]/ \Delta t[/tex]= [tex]1.1875*10 ^{−7} mol/(L.s)[/tex]

Trial 3: [A] = 0.078 M, [B] = [tex]0.065 M, \Delta [A]/ \Delta t[/tex] = [tex]3.9625* 10^{−7} mol/(L.s)[/tex]

Comparing Trials 1 and 2, we can see that when [B] is increased from 0.065 M to 0.078 M, the rate decreases by a factor of approximately 2. Comparing Trials 1 and 3, when [A] is increased from 0.065 M to 0.078 M, the rate increases by a factor of approximately 2.

Therefore, the rate law expression can be simplified as:

Rate = k[A][B]

To know more about rate law expression, here

brainly.com/question/15087107

#SPJ4

additional energy can be provided and body fat can be made when amino acids are converted to

Answers

Amino acids can be converted into triglycerides to provide additional energy and generate body fat. Triglycerides are the primary form of stored fat in the body and are composed of three fatty acid molecules attached to a glycerol backbone. Here option C is the correct answer.

The process by which amino acids are converted into triglycerides is known as lipogenesis. During lipogenesis, excess amino acids that are not needed for protein synthesis can be broken down and converted into intermediate molecules, such as acetyl-CoA.

Acetyl-CoA serves as a building block for fatty acid synthesis. Through a series of enzymatic reactions, acetyl-CoA is combined with other molecules to form fatty acids, which are then incorporated into triglycerides.

This conversion primarily occurs in the liver, although adipose tissue (fat cells) also plays a role in storing triglycerides. When the body requires energy, triglycerides can be hydrolyzed back into fatty acids and glycerol through a process called lipolysis. Fatty acids can then be metabolized and used as a source of energy through beta-oxidation.

To learn more about triglycerides

https://brainly.com/question/13840067

#SPJ4

Complete question:

Which of the following substances do amino acids get converted into to provide additional energy and generate body fat?

a) Glucose

b) Glycogen

c) Triglycerides

d) Ketones

part a what is the percentage composition by mass of naclo in the bleach product? express your answer to three significant figures and include the appropriate units.

Answers

Answer:

6%.

Explanation:

To calculate the percentage composition by mass of NaClO in the bleach product, we need to determine the molar mass of NaClO and the molar mass of the entire bleach product.

The molar mass of NaClO can be calculated as:

NaClO = 1 mol Na + 1 mol Cl + 1 mol O

= 22.99 g/mol + 35.45 g/mol + 16.00 g/mol

= 74.44 g/mol

The molar mass of the entire bleach product is not provided, so we cannot calculate the exact percentage composition. However, typical household bleach products contain between 5% and 8.25% NaClO by mass.

Assuming a hypothetical bleach product that contains 6% NaClO by mass, we can calculate the mass percentage as follows:

Mass percentage of NaClO = (mass of NaClO / mass of bleach product) x 100%

= (6 g NaClO / 100 g bleach product) x 100%

= 6%

Therefore, the percentage composition by mass of NaClO in the bleach product is 6%.

1. Draw the skeletal formula of linolenic acid. Why is it an unsaturated fatty acid?

2. What type of solvent is needed to remove an oil spot? Why?

3. Write the equation for the esterification of glycerol and three palmitic acids.

Answers

1. The skeletal formula of linolenic acid (specifically α-linolenic acid) is CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH.
2. A nonpolar solvent, such as hexane or ether, is needed to remove an oil spot.
3. The esterification equation
C3H5(OH)3 + 3 CH3(CH2)14COOH → C3H5(OCO(CH2)14CH3)3 + 3 H2O

1. The skeletal formula for linolenic acid is:
H3C-(CH2)4-CH=CH-CH2-CH=CH-CH2-CH=CH-(CH2)7-COOH
It is an unsaturated fatty acid because it contains at least one double bond in its carbon chain, which means it has fewer hydrogen atoms than a saturated fatty acid with the same number of carbons.
2. The type of solvent needed to remove an oil spot depends on the type of oil and the surface it has stained. Generally, nonpolar solvents like hexane, benzene, or acetone are effective for removing oil spots because they dissolve oils and fats. This is because oil and fat molecules are nonpolar, and like dissolves like. However, the choice of solvent should be based on the surface being cleaned and the safety considerations associated with the solvent.
3. The equation for the esterification of glycerol and three palmitic acids is:
3 C16H32O2 + C3H5(OH)3 → C3H5(C16H31O2)3 + 3 H2O
This equation represents the reaction between glycerol (C3H5(OH)3) and three palmitic acids (C16H32O2) to form tri-palmitin (C3H5(C16H31O2)3) and three molecules of water (H2O). This reaction is an example of esterification, where an ester is formed by the reaction of an alcohol and a carboxylic acid.

To know more about linolenic acid visit:

https://brainly.com/question/30690127

#SPJ11

Express the rate of the reaction in terms of the rate of concentration change for each of the three species involved. 2 NO 02 + 2 NO 1 rate of reaction - = 2 Incorrect rate of reaction 1 Incorrect rate of reaction = 2 Incorrect

Answers

d[NO]/dt, d[O2]/dt, and d[NO2]/dt represent the rates of change in concentration of NO, O2, and NO2, respectively.

2 NO + O2 → 2 NO2

To express the rate of reaction in terms of the concentration change for each species involved, you can write it as:

Rate of reaction = - (1/2) * d[NO]/dt = - d[O2]/dt = (1/2) * d[NO2]/dt

Here, d[NO]/dt, d[O2]/dt, and d[NO2]/dt represent the rates of change in concentration of NO, O2, and NO2, respectively. The negative signs indicate that the concentration of reactants (NO and O2) decreases, while the positive sign indicates that the concentration of the product (NO2) increases as the reaction proceeds.To express the rate of the reaction in terms of the rate of concentration change for each of the three species involved, we need to determine the stoichiometry of the reaction and apply the rate law.

The given reaction is:

2 NO + O2 → 2 NO2

Let's define the rate of the reaction as the change in concentration of any of the reactants or products over time. We'll use square brackets to denote concentration.

The rate of the reaction can be expressed as:

Rate = Δ[NO] / Δt = -1/2 * Δ[O2] / Δt = 1/2 * Δ[NO2] / Δt

The negative sign in front of Δ[O2] accounts for the fact that the concentration of O2 decreases over time, while the concentrations of NO and NO2 increase.

Note that the stoichiometric coefficients in the balanced equation determine the ratio of the rate of concentration change for each species. In this case, 2 moles of NO react with 1 mole of O2 to produce 2 moles of NO2. Hence, the rate of concentration change of NO is equal to the rate of concentration change of O2 (with opposite signs), while the rate of concentration change of NO2 is half the magnitude of the rates for NO and O2.

Therefore, the rate of the reaction can be expressed as:

Rate = -Δ[NO] / (2 * Δt) = -Δ[O2] / (2 * Δt) = 1/2 * Δ[NO2] / Δt

The negative signs in front of Δ[NO] and Δ[O2] indicate the decrease in their concentrations, while the positive sign in front of Δ[NO2] indicates the increase in its concentration over time.

To know more about rate of reaction visit:
https://brainly.com/question/28566775

#SPJ11

when pouring from a stock solution bottle, where should you hold onto the bottle?

Answers

When pouring from a stock solution bottle, it is generally recommended to hold onto the bottle by grasping the body of the bottle itself. Here's a detailed explanation: Stability, Spillage Prevention, Accurate Pourin

Stability: Holding the bottle by its body provides better stability and control over the pouring process. The body of the bottle is usually designed to provide a firm grip, allowing you to have better control over the pouring angle and flow rate.

Spillage Prevention: Holding the bottle by its body helps minimize the risk of spilling or tipping the bottle. The body of the bottle is typically wider and more stable compared to the neck or cap. By holding onto the body, you can maintain a better balance and reduce the likelihood of accidental spills.

Accurate Pouring: Holding the bottle by the body allows you to have a clearer view of the pouring spout or opening. This visibility helps ensure that you can accurately aim and control the pouring of the stock solution without splashing or wasting the liquid.

Know more about stock solution here:

https://brainly.com/question/27304546

#SPJ11

The base ionization constant of ammonia is 1.8 × 〖10〗^(-5). In a 0.020 M NH3 solution, what percentage of the NH3 is present as NH^+?

Answers

Approximately 0.95% of the ammonia is present as [tex]NH^+[/tex] in the 0.020 M [tex]NH_3[/tex] solution.

The base ionization constant, also known as the base dissociation constant or Kb, represents the extent of ionization of a base in an aqueous solution. In the case of ammonia, the Kb value is given as [tex]1.8 \times 10^{(-5)[/tex].

To determine the percentage of [tex]NH_3[/tex] that is present as [tex]NH^+[/tex] in a 0.020 M [tex]NH_3[/tex] solution, we can use the expression for Kb and the equilibrium expression for the ionization of [tex]NH_3[/tex]:

[tex]NH$_3$ + H$_2$O $\rightleftharpoons$ NH$_4^+$ + OH$^-$[/tex]

The Kb expression is as follows:

[tex]K$_b$ = $\frac{{[NH_4^+][OH^-]}}{{[NH_3]}}$[/tex]

Since we want to find the percentage of [tex]NH_3[/tex] that is present as [tex]NH^+[/tex], we need to calculate the concentration of [tex]NH4^+[/tex] relative to the initial concentration of [tex]NH_3[/tex].

Let's assume that x represents the concentration of NH4^+ and OH^-, and since [tex]NH_3[/tex] initially dissociates into NH4^+ and OH^- in a 1:1 ratio, we can also consider x as the concentration of NH4^+ and OH^-.

The concentration of [tex]NH_3[/tex] at equilibrium will be (0.020 - x) since some of it will have ionized into NH4^+ and OH^-.

Using the Kb expression and the equilibrium concentrations, we have:

[tex]$1.8 \times 10^{-5} = \frac{{x^2}}{{0.020 - x}}$[/tex]

To solve this equation, we can make the assumption that x is small compared to 0.020. Therefore, we can approximate (0.020 - x) as 0.020. By substituting this value, the equation becomes:

[tex]$1.8 \times 10^{-5} = \frac{{x^2}}{{0.020}}$[/tex]

Now, we can rearrange the equation to solve for x:

[tex]x^2 = 1.8 \times 10^{(-5)} \times 0.020[/tex]

[tex]x^2 = 3.6 \times 10^{(-7)[/tex]

[tex]$x = \sqrt{3.6 \times 10^{-7}}$[/tex]

[tex]$x \approx 1.9 \times 10^{-4}$[/tex]

The concentration of NH4^+ and OH^- is approximately [tex]$x \approx 1.9 \times 10^{-4}$[/tex] M.

To find the percentage of NH3 that is present as NH^+, we divide the concentration of NH4^+ by the initial concentration of NH3 and multiply by 100:

Percentage = [tex](1.9 \times 10^{(-4)} / 0.020) \times 100[/tex]

Percentage ≈ 0.95%

Therefore, approximately 0.95% of the NH3 is present as NH^+ in the 0.020 M NH3 solution.

To learn more about ammonia

https://brainly.com/question/29574773

#SPJ4

A solution is prepared at 25°C that is initially0.22M in ammonia NH3, a weak base with=Kb×1.810?5, and 0.073Min ammonium chloride NH4Cl. Calculate the pH of the solution. Round your answer to 2 decimal places.

Answers

The pH of the solution, prepared at 25°C and initially 0.22 M in ammonia (NH₃) and 0.073 M in ammonium chloride (NH₄Cl), is approximately 9.52.

To calculate the pH of the solution, we need to consider the dissociation of ammonia (NH₃) as a weak base and the presence of ammonium chloride (NH₄Cl) as a source of chloride ions (Cl⁻). The chloride ions do not affect the pH significantly, but they will react with the NH₃ to form NH₄⁺ ions.

The dissociation of NH₃ can be represented as follows:

NH₃ + H₂O ⇌ NH₄⁺ + OH⁻

We can set up an equilibrium expression using the given base dissociation constant (Kb) value of NH₃:

Kb = [NH₄⁺][OH⁻] / [NH₃]

Given:

Initial concentration of NH₃ (ammonia) = 0.22 M

Concentration of NH₄Cl (ammonium chloride) = 0.073 M

Kb (base dissociation constant of NH₃) = 1.8 x 10⁻⁵

First, we need to calculate the concentration of OH⁻ ions:

Kb = [NH₄⁺][OH⁻] / [NH₃]

1.8 x 10⁻⁵ = (x)(x) / (0.22 - x)

Approximating 0.22 - x as 0.22, we get:

1.8 x 10⁻⁵ ≈ x² / 0.22

Solving for x (concentration of OH⁻):

x ≈ 0.00813 M

Next, we use the concentration of OH⁻ to calculate the concentration of H⁺ (hydrogen ions):

[H⁺] = Kw / [OH⁻]

[H⁺] = 1 x 10⁻¹⁴ / 0.00813 ≈ 1.23 x 10⁻¹² M

Finally, we find the pH:

pH = -log[H⁺]

pH = -log(1.23 x 10⁻¹²) ≈ 9.52

learn more about pH here:

https://brainly.com/question/26856926

#SPJ4

if the density of a certain alchol is 0.785 g/ml, what mass of the alchol would hace a volume of 200.0 ml?

Answers

If the density of a certain alchol is 0.785 g/ml, 157g mass of the alchol would hace a volume of 200.0 ml .

What is  density?

Density is a physical property of a substance that is defined as the mass per unit volume. It is a measure of the amount of matter contained in a given volume of an object. It is expressed in units of grams per cubic centimeter (g/cm3). Density is a fundamental property of matter and is an important factor in determining the structure, reactivity, and other properties of materials. Density plays an important role in the design and construction of objects such as vehicles, buildings, and bridges. It is also useful in determining the behavior of fluids and gases under certain conditions.

Density is a measure of mass per unit volume, so to calculate the mass

To learnof the alcohol with a volume of 200ml, we can use the following equation:Mass = Density×Volume

Therefore, the mass of the alcohol = 0.785 g/ml×200.0 ml = 157 g

To learn more about density

https://brainly.com/question/406690

#SPJ4

CO + H2O ← → CO2 + H

Keq = 5.1 at 700 0C

If 1mol of each species are mixed in a 1L flask, which of following statements is true.



Your answer:

The concentration of CO and H2O are decreasing by x.


The concentration of CO2 and H are decreasing by x.


The reaction is already at equilibrium.


The reaction is complete.

Answers

The concentration of CO and H2O are decreasing by x, as the forward reaction will proceed to consume CO and H2O and produce CO2 and H until the reaction reaches equilibrium. Option A

The equilibrium constant, Keq, for the reaction CO + H2O ← → CO2 + H is given as 5.1 at 700°C. If 1 mole of each species is mixed in a 1L flask, we can use the given equilibrium constant to predict the direction in which the reaction will proceed.

The reaction quotient, Q, is given by the ratio of the concentrations of the products to reactants, raised to their stoichiometric coefficients. Initially, the concentrations of all the species are equal to 1 M. Therefore, the reaction quotient is:

Q = [CO2][H]/[CO][H2O] = (1 x 1)/(1 x 1) = 1

Comparing Q and Keq, we find that Q < Keq. This means that the reaction is not yet at equilibrium, and the forward reaction will proceed to reach equilibrium.

Therefore, the correct answer is (A) The concentration of CO and H2O are decreasing by x, as the forward reaction will proceed to consume CO and H2O and produce CO2 and H until the reaction reaches equilibrium. Option A

For more such questions on equilibrium visit:

https://brainly.com/question/13414142

#SPJ11

based on the vapo-pressure curve for (ch3)3coh, which is its normal boiling point?

Answers

The normal boiling point of (CH3)3COH can be found on the vapo-pressure curve at the point where the vapor pressure of the substance is equal to the standard atmospheric pressure of 1 atm.

The vapor pressure of a substance increases as its temperature increases. At the boiling point, the vapor pressure of the substance is equal to the atmospheric pressure, causing bubbles of vapor to form throughout the liquid. The normal boiling point is the temperature at which the vapor pressure of the substance is equal to the standard atmospheric pressure of 1 atm.

Therefore, to find the normal boiling point of (CH3)3COH, we need to look for the point on its vapo-pressure curve where the vapor pressure is equal to 1 atm. Once we find this point, we can read off the corresponding temperature, which is the normal boiling point of the substance.
To know more about boiling visit:

https://brainly.com/question/28203474

#SPJ11

what needs to be done to convert a neutral nitrogen atom into an n-3 species?

Answers

To convert a neutral nitrogen atom into an n-3 species, it needs to be incorporated into a larger molecule with specific properties.

N-3 species are a type of polyunsaturated fatty acid (PUFA) that have a double bond at the third carbon from the end of the carbon chain. This double bond is crucial for the biological activity of n-3 PUFAs, which are essential nutrients for human health.
The process of converting a neutral nitrogen atom into an n-3 species involves the synthesis of these fatty acids. This can be achieved through either endogenous or exogenous pathways. Endogenous pathways involve the body's own enzymes and metabolic processes to create the fatty acids from precursors. Exogenous pathways involve consuming n-3 PUFAs in the diet or taking supplements.
The most common n-3 species are EPA (eicosapentaenoic acid) and DHA (docosahexaenoic acid), which are found in fish and other marine sources. These can be converted from the precursor alpha-linolenic acid (ALA) through a series of enzyme-catalyzed reactions.

In summary, to convert a neutral nitrogen atom into an n-3 species, it needs to be incorporated into a larger molecule through the synthesis of polyunsaturated fatty acids. This can be achieved through endogenous or exogenous pathways, resulting in the essential nutrients EPA and DHA.

To know more about nitrogen atom visit:

https://brainly.com/question/15842685

#SPJ11

what is the quantitative relationship between ph and hydrogen ion concentration in solution?

Answers

The quantitative relationship between pH and hydrogen ion concentration in a solution is given by the formula pH = -log10[H+], where pH represents the pH value and [H+] denotes the hydrogen ion concentration in moles per liter (M). This equation shows that the pH is the negative logarithm of the hydrogen ion concentration, indicating an inverse relationship between them. As the hydrogen ion concentration increases, the pH value decreases, and vice versa.

The quantitative relationship between pH and hydrogen ion concentration in a solution can be described by the following equation:
pH = -log[H+]
Here, pH represents the measure of the acidity or basicity of a solution, while [H+] represents the concentration of hydrogen ions in the solution. As the concentration of hydrogen ions increases, the pH of the solution decreases, indicating a more acidic solution. Conversely, as the concentration of hydrogen ions decreases, the pH of the solution increases, indicating a more basic solution. Therefore, there is an inverse relationship between pH and hydrogen ion concentration in a solution.
To know more about pH value visit:

https://brainly.com/question/28580519

#SPJ11

What are the 3 main points of the kinetic molecular theory of gases?


size, motion, energy

size, density, attraction

attraction, compression, force

density, velocity, collisions

Answers

The 3 main points of the kinetic molecular theory of gases are:

size, motion, energy

Main points of the kinetic molecular theory of gases

Size: according to the kinetic molecular theory, gas particles are considered to have negligible size compared to the distance between them.

Motion: gas particles are in constant, random motion. They move in straight lines  until they collide with other particles or the walls of the container.

Energy: gas particles possess kinetic energy due to their motion. The average kinetic energy of the gas particles is directly proportional to the absolute temperature of the gas.

Learn more about kinetic molecular theory of gases at

https://brainly.com/question/134712

#SPJ1

Which of these is the dominant mechanism for the removal of carbon dioxide from the atmosphere?A) subductionB) photosynthesis in plantsC) dissolving carbon dioxide in seawaterD) formation of carbonate-rich rocks at the seafloor

Answers

The dominant mechanism for the removal of carbon dioxide from the atmosphere is the process of photosynthesis in plants. During this process, carbon dioxide is absorbed by plants and converted into organic matter, which is then used for plant growth and development. This mechanism is important because it not only removes carbon dioxide from the atmosphere but also produces oxygen, which is essential for the survival of many living organisms.

Although photosynthesis is the primary mechanism for the removal of carbon dioxide from the atmosphere, other processes also play a role. One such process is the dissolution of carbon dioxide in seawater, which can result in the formation of carbonate ions. These carbonate ions can then react with calcium ions in seawater to form calcium carbonate, which can eventually settle on the seafloor and form carbonate-rich rocks.

Subduction, on the other hand, is a process by which one tectonic plate is forced beneath another. This process does not directly remove carbon dioxide from the atmosphere, but it can contribute to the removal of carbon dioxide over long periods of time. When tectonic plates are forced beneath one another, they can carry carbon-rich sediments with them, which can then be subjected to high temperatures and pressures, causing them to release carbon dioxide into the atmosphere.

To learn more about carbon dioxide visit:-

https://brainly.com/question/3049557

#SPJ11

if carbon-14 is a beta emitter, what is the likely product of radioactive decay?

Answers

When carbon-14 undergoes radioactive decay, it emits a beta particle, which is essentially a high-energy electron.

This beta particle is ejected from the nucleus of the carbon-14 atom, along with an antineutrino, which is a subatomic particle with no charge and very little mass. The carbon-14 nucleus then undergoes a transformation, becoming a new nucleus with one more proton and one less neutron. This new nucleus is nitrogen-14, which is a stable, non-radioactive isotope. So, the likely product of the radioactive decay of carbon-14 is nitrogen-14, which is the end result of the process. This transformation is known as beta decay and is a common mode of radioactive decay for many isotopes.

To know more about radioactive decay visit:

https://brainly.com/question/1770619

#SPJ11

A graduate student (Yennefer) prepared a nanocomposite that contains a polymer matrix (poly-lactide- co-glycolide, abbreviated as PLGA) and hydroxyapatite nanoparticles. She mixed them to give a weight ratio of PLGA/hydroxyapatite =60/40. Yennefer dispersed her hydroxyapatite nanoparticles in the PLGA scaffold, which has a dimension of 20x20x1 mm. The hydroxyapatite nanoparticles she synthesized has a cylindrical shape with a diameter of 4 nm and length of 42 nm. She used PLGA with a lactic acid to glycolic acid ratio of 50:50. if her particles agglomerated into spherical aggregates with average size of 2 µm, how many aggregates would she have in her scaffold?

Answers

Yennefer would have approximately 3.15 x 10^13 aggregates in her scaffold.

Find the number of aggregates in the scaffold?

To calculate the number of aggregates in the scaffold, we need to determine the number of aggregates per unit volume and then multiply it by the volume of the scaffold.

Determine the volume of a single aggregate:

The diameter of the spherical aggregates is given as 2 µm, which corresponds to a radius of 1 µm or 1 x 10^3 nm.

The volume of a sphere is given by V = (4/3)πr³, where r is the radius.

Therefore, the volume of a single aggregate is V_aggregate = (4/3)π(1 x 10^3 nm)³.

Calculate the volume of the scaffold:

The dimensions of the scaffold are given as 20 x 20 x 1 mm, which is equivalent to 20 x 10³ nm x 20 x 10³ nm x 1 x 10³ nm.

The volume of the scaffold is V_scaffold = 20 x 10³ nm x 20 x 10³ nm x 1 x 10³ nm.

Determine the number of aggregates in the scaffold:

The number of aggregates in the scaffold can be calculated by dividing the volume of the scaffold by the volume of a single aggregate:

Number of aggregates = V_scaffold / V_aggregate.

Substituting the values and performing the calculations, we find that Yennefer would have approximately 3.15 x 10^13 aggregates in her scaffold.

To know more about sphere, refer here:

https://brainly.com/question/15044609#

#SPJ4

Properties of Acids and Bass Name: ClassLab Period: Properties of Acids and Bases Data Table A. Classifying Acids and Bases Solution 3 1 2 4 5 Acetic Hydrochloric ACT Distilled Water Sodium Hydroxide Acid Ammonia Test Property Conductivity good / poor Ø poor good Litmus Paper Phenolphthalein pH Test Paper pink turned Rod bles cloudy (chudy Idankpink dartant dank pink 4 8 13 red dankhoe red danepal green blue blue purple bubbles bubbles reaction reaction reaction. Universal Indicator Reaction with Magnesium Acetic Acid Data Table B. Neutralization Reactions of Acids and Bases Hydrochloric Acid Number of Drops of Sodium Hydroxide Added (Trial 1) 20 Number of Drops of Sodium Hydroxide Added (Trial 2) 20 20 20 Properties of Acids and Bases Properties of Acids and Bases - Page 6 Post-Lab Questions tbe a separate sheet of paper to answer the following questions.) Use the results of the conductivity test to identify each solution in Part A as a strong elec- trolyte, weak electrolyte, or nonelectrolyte 2. Which solutions in Part A reacted with magnesium metal? Write a balanced chemical equation for the reaction of each acid in Part A with magnesium 3. Strong acids ionise completely in water to form ions and are thus strong electrolytes. In contrast, wvuk acids do not readily ionise in water in fact, less than 1% of the mole. cules are probably lonized at any given time. Weak acids are therefore weak electrolytes. Classily each acid as either a strong or weak acid. Which reacted faster with magnesium metal, the strong acid or the weak acid? 4. Write chemical equations for ionisation of the strong and weak acids in water. Identify the common ion that is produced in acidic solutions. How can litmus paper and phenolphthalein be used to tell whether a solution is an acid or a base? He specific 6. Use the combined results of the conductivity and indicator tests to identify the basic solu- tions in Part A. Classify cach as a strony versus a base Write chemical equations for the ion-forming reactions of the strong and weak bases in water. Identify the common son that is produced in basic solutions. & Compare the phl data for the solutions which you labeled as acids and bases. What pH val. ues can be assigned to acids and bases, respectively? 9. Compare the privalues of stron verses weak acid and strong versus weak base solutions. How does Nl vary with the strength of an acid or base, respectively? 10. Explain the color change observed for the indicator in the neutralization reaction of hydrochloric acid in Part B. What is the pH range of the final solution? 11. (a) Write separate, balanced equations for the neutralization reactions of hydrochloric acid and acetic acid with sodium hydroxide. (b) Use the stoichiometry of the balanced chemical equations to explain the number of drops of sodium hydroxide required for complete neutralization of the acids. (c) Did the strong and weak acids require equal number of drops of sodium hydroxide? Explain. (d) Did adding water to the acid solutions change the number of drops of sodium hydrox- ide required for neutralization Explain. Complete the following table to summarize the properties of acids and bases. Property Acids Bases Conductivity Litmus Yes Yes Phenolphthalein pink Reaction with metals no reaction 27 yes yes cola leo produces salt hupengendas pH Flinn Chem Topic" Labs --Acids and Bases

Answers

Use the results of the conductivity test to identify each solution in Part A as a strong electrolyte, weak electrolyte, or nonelectrolyte: Strong electrolyte: Hydrochloric acid and Weak electrolyte: Acetic acid.

Nonelectrolyte: Distilled water, Sodium hydroxide, Ammonia

Which solutions in Part A reacted with magnesium metal? Write a balanced chemical equation for the reaction of each acid in Part A with magnesium:

Hydrochloric acid: Mg (s) + 2HCl (aq) → [tex]MgCl_2[/tex] (aq) + [tex]H_2[/tex] (g)

Acetic acid: Mg (s) + [tex]CH_3COOH[/tex] (aq) → Mg( [tex]CH_3COOH[/tex]) (aq) + [tex]H_2O[/tex] (l)

Strong acids ionize completely in water to form ions and are thus strong electrolytes. In contrast, weak acids do not readily ionize in water, in fact, less than 1% of the molecules are probably ionized at any given time. Classify each acid as either a strong or weak acid:

Hydrochloric acid: Strong acid

Acetic acid: Weak acid

Write chemical equations for ionization of the strong and weak acids in water. Identify the common ion that is produced in acidic solutions:

Hydrochloric acid: H+ + Cl- → HCl

Acetic acid:  [tex]CH_3COOH[/tex] →  [tex]CH_3COO[/tex]- + H+

Common ion: H+

How can litmus paper and phenolphthalein be used to tell whether a solution is an acid or a base?

Litmus paper: Acidic solutions turn red, while basic solutions turn blue.

Phenolphthalein: Acidic solutions turn pink, while basic solutions turn colorless.

Use the combined results of the conductivity and indicator tests to identify the basic solutions in Part A. Classify each as a strong or weak base:

Strong base: Sodium hydroxide

Weak base: Ammonia

In Part B, the post-lab questions are included, where students are asked to apply their knowledge of acid-base reactions to different scenarios.  

Learn more about conductivity visit: brainly.com/question/28869256

#SPJ4

Final answer:

The question asks about properties of strong weak acids and bases and how they react, demonstrated by their conductivity, reaction with magnesium metal and their effect on litmus paper, phenolphthalein, and pH levels. Strong acids and bases have higher levels of ionic disassociation, leading to greater conductivity and more extreme pH values. Moreover, in a neutralization reaction, the color change of an indicator corresponds to the new pH level.

Explanation:

From the provided data table, strong electrolytes would include Sodium Hydroxide and Hydrochloric Acid due to their good conductivity, whereas weak electrolytes like Acetic Acid display poor conductivity.

The reactions with magnesium would happen in solutions that are acidic. For instance, Hydrochloric Acid would react with magnesium to create Hydrogen gas and a Salt compound, generating bubbles noticeable in the test. The balanced chemical equation would be: Mg + 2HCl → MgCl2 + H2.

Strong acid is quicker in reacting with Magnesium metal than weak acid, as strong acid ionise completely in water producing larger amount of H+ ions than weak acids.

Litmus paper and phenolphthalein are used to identify whether a solution is an acid or a base. Litmus paper turns red when dipped in acidic solutions and blue in basic solutions. Phenolphthalein is colorless in acidic solutions and turns pink in basic solutions.

In regards to pH values, 'acidic' solutions typically have a pH of less than 7, and 'basic' solutions have a pH of higher than 7. Strong acids and strong bases typically have extreme pH values, while weak acids and weak bases will have pH values relatively closer to neutral (7).

During neutralization, Neutralization changes the color of an pH indicator to the corresponding color of the new pH level, such as changing a strong acid with low pH yellow to a greenish color as the pH increases towards neutral after adding a base.

Learn more about Acids and Bases here:

https://brainly.com/question/31907617

#SPJ11

Four balloons, each with a mass of 10.0 g, are inflated to a volume of 20.0 L, each with a different gas: helium, neon, carbon monoxide, or nitrogen monoxide. If the temperature is 25 degrees C and the atmospheric pressure is 1.00 atm, what is the density of each filled balloon? Helium= ? g/mL Neon= ? g/mL Carbon monoxide= ? g/mL Nitrogen monoxide= ? g/mL If the density of air at 25 degrees C and 1.00 atm is 0.00117 g/mL, will any of the balloons float in this air? Which ones?

Answers

To find the density of each filled balloon, we need to use the ideal gas law equation:

PV = nRT

Where:

P = Pressure (in atm)

V = Volume (in L)

n = Number of moles

R = Ideal gas constant (0.0821 L·atm/(mol·K))

T = Temperature (in Kelvin)

We can rearrange the equation to solve for the number of moles (n):

n = PV / RT

Given that the mass of each balloon is 10.0 g and we know the molar mass of each gas, we can calculate the number of moles (n) using the formula:

n = mass / molar mass

Finally, we can calculate the density using the equation:

Density = mass / volume

Let's calculate the density for each gas:

1. Helium (He):

Molar mass of helium (He) = 4.00 g/mol

Number of moles (n) = 10.0 g / 4.00 g/mol = 2.50 mol

Density = 10.0 g / 20.0 L = 0.50 g/L = 0.00050 g/mL

2. Neon (Ne):

Molar mass of neon (Ne) = 20.18 g/mol

Number of moles (n) = 10.0 g / 20.18 g/mol = 0.495 mol

Density = 10.0 g / 20.0 L = 0.50 g/L = 0.00050 g/mL

3. Carbon monoxide (CO):

Molar mass of carbon monoxide (CO) = 28.01 g/mol

Number of moles (n) = 10.0 g / 28.01 g/mol = 0.357 mol

Density = 10.0 g / 20.0 L = 0.50 g/L = 0.00050 g/mL

4. Nitrogen monoxide (NO):

Molar mass of nitrogen monoxide (NO) = 30.01 g/mol

Number of moles (n) = 10.0 g / 30.01 g/mol = 0.333 mol

Density = 10.0 g / 20.0 L = 0.50 g/L = 0.00050 g/mL

Now, let's compare the density of air (0.00117 g/mL) with the density of each filled balloon:

- Helium: 0.00050 g/mL

- Neon: 0.00050 g/mL

- Carbon monoxide: 0.00050 g/mL

- Nitrogen monoxide: 0.00050 g/mL

Since the density of each filled balloon is lower than the density of air, all four balloons (helium, neon, carbon monoxide, and nitrogen monoxide) will float in the given air.

To know more about density refer here

https://brainly.com/question/28547725#

#SPJ11

Select all of the combinations of solid-solutions will produce no temperature change. a. Ag-Cu(NO3)2b. Cu-Cu(NO3)2c. Mg-Cu(NO3)2d. Zn-Cu(NO3)2

Answers

The combinations of solid-solutions that will produce no temperature change are b. Cu-Cu(NO₃)₂ and d. Zn-Cu(NO₃)₂.

A solid-solution is a mixture of two or more substances that form a solid-state solution. When two substances form a solid-solution, they may produce a temperature change, which can either be an exothermic or endothermic reaction. An exothermic reaction releases heat energy, while an endothermic reaction absorbs heat energy.

In the given combinations, only the solid-solutions of Cu-Cu(NO₃)₂ and Zn-Cu(NO₃)₂ will not produce any temperature change. This is because both copper and zinc have the same crystal structure and atomic radius as their respective ions in the nitrate solution, resulting in no net energy exchange during the mixing process.

In conclusion, the solid-solutions of Cu-Cu(NO₃)₂ and Zn-Cu(NO₃)₂ will not produce any temperature change, while the other combinations of Ag-Cu(NO₃)₂ and Mg-Cu(NO₃)₂ will produce a temperature change during the mixing process.

To know more about solid-solutions, visit:

https://brainly.com/question/9079923

#SPJ11

once neurotransmitters are released, they do not remain in the synapse. what happens to them?

Answers

Once neurotransmitters are released into the synapse, they can bind to receptors on the postsynaptic neuron, initiating a response. However, they do not remain in the synapse indefinitely. After serving their purpose, neurotransmitters are either reabsorbed by the presynaptic neuron through a process called reuptake or are broken down by enzymes. These mechanisms help maintain proper neurotransmitter levels, ensuring efficient communication between neurons and preventing overstimulation or excessive inhibition of neuronal activity.

Neurotransmitters are chemicals released from one neuron to communicate with another neuron. Once released, they diffuse across the synapse and bind to specific receptors on the postsynaptic neuron. However, not all of the neurotransmitters bind to receptors and some may be reabsorbed by the presynaptic neuron through a process called reuptake. This allows for the recycling of neurotransmitters and prevents them from remaining in the synapse for too long. Some neurotransmitters may also be broken down by enzymes in the synapse or taken up by nearby glial cells. Overall, the removal of neurotransmitters from the synapse helps to regulate the communication between neurons and maintain proper functioning of the nervous system.
To know more about neurotransmitters visit:

https://brainly.com/question/28101943

#SPJ11

suggest an assignment for / 350, 315, 280, 245, and 210 in the high-mass region of the electron ionization mass spectrum. enter the formulas in the form clacbhcnd.

Answers

Here are some possible assignment suggestions for the given ionization energies:

[tex]C_2+: 350 eV\\C+: 315 eV\\C_3+: 280 eV\\C_4+: 245 eV\\C_5+: 210 eV[/tex]

These assignments are based on the order of increasing ionization energy, which is typically seen in the high-mass region of an electron ionization spectrum. However, it's important to note that ionization energies can vary depending on the specific conditions and details of the experiment.  

In general, the ionization energies of the noble gases decrease as the atomic number increases, because the innermost shells of these atoms are relatively small and can more easily be ionized. However, the ionization energies of the heavier elements increase again as the atomic number increases, because the outermost shells of these atoms are larger and more difficult to ionize.

Learn more about ionization visit: brainly.com/question/30831422

#SPJ4

Imagine distilling a mixture of the six compounds listed below. Which compound would boil at the lowest temperature, and be the first to distill?a. CH3CH2CH2CH2-CI b. CH3CH2CH2CH2-NH2 c. CH3CH2CH2CH2-OH d. CH3CH2CH=CHCH3 e. CHCHC=OCH3 f. CH3CH2CH2COOH

Answers

When distilling a mixture of compounds, the boiling points of the individual compounds determine their order of distillation. Compounds with lower boiling points will vaporize and condense back into a liquid state at lower temperatures compared to compounds with higher boiling points.

In the given list of compounds, compound c, CH3CH2CH2CH2-OH, is an alcohol known as butanol. Alcohols generally have lower boiling points compared to other compounds listed. This is because alcohols exhibit intermolecular hydrogen bonding, which weakens the attractive forces between molecules and makes it easier for them to escape as vapor.

The other compounds in the list are:

a. CH3CH2CH2CH2-Cl: This is a chlorinated alkane. Chlorinated compounds typically have higher boiling points than their corresponding hydrocarbons due to the polarity introduced by the chlorine atom.

b. CH3CH2CH2CH2-NH2: This is an amine known as butylamine. Amines generally have higher boiling points compared to hydrocarbons due to intermolecular hydrogen bonding.

d. CH3CH2CH=CHCH3: This is an alkene known as 2-pentene. Alkenes generally have lower boiling points than alcohols and amines.

e. CH3CH=C=OCH3: This is a ketone known as methyl ethyl ketone. Ketones generally have higher boiling points than alkenes but lower boiling points than alcohols and amines.

f. CH3CH2CH2COOH: This is a carboxylic acid known as butanoic acid. Carboxylic acids typically have higher boiling points than alcohols, amines, alkenes, and ketones due to stronger intermolecular hydrogen bonding.

Therefore, among the given compounds, CH3CH2CH2CH2-OH (butanol) would have the lowest boiling point and be the first to distill.

To know more about compounds refer here

https://brainly.com/question/14117795#

#SPJ11

Other Questions
a study on the latest fad diet claimed that the amounts of weight lost by all people on this diet had a mean of 22.5 pounds and a standard deviation of 5.9 pounds. step 2 of 2: if a sampling distribution is created using samples of the amounts of weight lost by 72 people on this diet, what would be the standard deviation of the sampling distribution of sample means? round to two decimal places, if necessary. The junction of the small and large intestines is marked by a pronounced muscular swelling known as the _sphincter, which regulates movement into the large intestine. show that the product of lower (resp. upper) triangular matrices is lower (resp. upper) triangular. show that if a lower (resp. upper) triangular matrix is invertible, then its inverse is lower (resp. upper) triangular Which of the following are considered criteria that the average American uses to evaluate presidential leadership?1. whether the president is generally respected around the world.2. whether the president prioritizes many of the same issues that concern much of the public.3. whether the president is a strong leader unafraid to exercise power and to communicate a vision for the nation. Phagocytosis leads to destruction of engulfed pathogens by:_________ Calcium crystallizes with a body-centered cubic structure.1) How many Ca atoms are contained in each unit cell?2) How many nearest neighbors does each Ca atom possess?3) Estimate the length of the unit cell edge, a, from the atomic radius (r) of calcium, 1.97 A culture medium consisting of agar, peptone and beef heart is aselective mediumcomplex mediumchemically defined mediumdifferential medium Who will likely have a higher car insurance premium -- Jacob (age 17) or his mother (age 47)? Why? help me please with this Should the governor and lieutenant governor both be out of the state at the same time,a. the president pro tempore of the Senate becomes acting governor.b. a special election is held, and the office is filled by direct popular vote.c. the Texas Senate selects one of its members to become governor.d. the senator with the most seniority becomes governor. a premature infant is born prior to the completion of ________ weeks of gestation. find an equation of the tangent plane to the given surface at the specified point. z = 2(x 1)2 3(y 3)2 6, (2, 1, 20) what is the independent variable for the following hypothesis: taller people will have larger feet? MULTIPLE CHOICE! WILL GIVE BRAINLIEST!!! Richard is a happily married man with children who is a successful kindergarten teacher. If Richard was raised to believe that women were better suited for teaching young children, he might experience1) a self-fulfilling prophecy2) the halo effect3) cognitive dissonance4) the foot-in-the-door phenomenon5) the just-world phenomenon discuss how you would go about teaching about, in and for the environment to address the challenge of biodiversity in school list three steps that can be taken to troubleshoot a windows startup issue. Which of the following statements concerning Easter Island and the Easter Islands impact on the island ecosystem is FALSE?Group of answer choices :a. Easter Island has relatively few fresh water sources, like lakes or springs, and generally unreliable seasonal rains.b. Charcoal deposits indicate that Easter Islanders engaged in widespread slash and burn agriculture that reduced the forests.c. Easter Islanders extensively used rock enclosures and rock mulch gardening to reduce moisture loss from crops due to wind.d. Easter Islanders altered the island ecology by bringing a variety of domestic crops to the island, along with chickens.e. Because Easter Island was formed by an oceanic hotspot, it has very rich volcanic soils that can support abundant vegetation. acquiring behavior is to maintaining behavior as _____ reinforcement is to _____ reinforcement. the violence committed against nonviolent freedom riders forced group of answer choices the desegregation of interstate transportation. congress to pass the voting rights act. laws against workplace discrimination. the desegregation of schools. Why was the potassium carbonate added during the isolation of the product?