Twice the difference of a number and 4 equals 3

Answers

Answer 1

Answer:

x - 4 x 2 = 3

Is your algebra expression.


Related Questions

Show that the following are equivalent, for Snopea filter Fonot todological Space X 9 f is if G is G an open set in C and CnH+ 0 s G for each Hef, then CEF c) iz G is G ° open and C & F, then X-cef ?

Answers

The given statement is true  (i) implies (ii) and (ii) implies (i).

The statement in the question that needs to be proven is :C & F, then X-cef = G is G an open set in C and CnH+ 0 s G for each Hef

We will prove that (i) implies (ii) and (ii) implies (i).

Proof: (i) C & F, then X-cef = G is G an open set in C and CnH+ 0 s G for each Hef

Let X \ {C & F} = U, then U is open, since C & F is closed.

Let H be any point of U.

By hypothesis, there exists an open set G such that CnH+ 0 s G.

Let x in G. If x ∈ C & F, then x ∉ H, so x ∉ U.

Thus, G ⊆ C, and so G ∩ U = ∅.

Hence, U is open(ii) G is G an open set in C and CnH+ 0 s G for each Hef

Let x ∈ X-C & F.

Then x ∉ C & F, so x ∉ C.

Since C is closed, there exists a neighborhood G of x that is disjoint from C.

Let H be any point of X-C & F.

Then H ∈ G and so CnH+ 0 s G.

Thus, C & F is closed.

Therefore, X-C & F is open, since C & F is closed.

Thus, X-C & F = G.

Hence, (ii) implies (i).

Therefore, the statement in the question is proven.

To learn more about open set

https://brainly.com/question/32510719

#SPJ11

PLEASE HELP I HAVE 5 MINUTES TO DO THIS AND I HAVE NO CLUE HOW
WILL MARK BRAINLIEST!!

Answers

A
B
C
A
. I think I wish you the best

Can anyone help find x?

Answers

Answer:

119

Step-by-step explanation:

Answer:

x= 61

Step-by-step explanation:

i think

Circle | was dilated with the orgin as the center of dilation to create Circle ||.
Which rule best represents the dilation applied to Circle | to create Circle ||?

Answers

Step-by-step explanation:

The rule that best represents the dilation applied to Circle | to create Circle || is the scale factor. The scale factor determines the ratio of corresponding lengths between the original figure (Circle |) and the dilated figure (Circle ||).

In a dilation, all lengths in the original figure are multiplied by the scale factor to obtain the corresponding lengths in the dilated figure. This includes the radii of the circles.

For example, if the scale factor is 2, it means that every length in the original figure is doubled in the dilated figure. If the scale factor is 1/2, it means that every length is halved. The scale factor can be greater than 1, less than 1 (but greater than 0), or even negative, indicating a reflection.

In the context of the given scenario, since the origin is the center of dilation, the scale factor determines how the distances from the origin to any point on Circle | are scaled to obtain the corresponding distances on Circle ||.

Find all of the eigenvalues of the matrix A over the complex numbers C. Give bases for each of the corresponding eigenspaces. A = [2 -1]
[ 1 2]
λ1 = ___ has eigenspace span (__) (λ-value with smaller imaginary part) λ2 ___ has eigenspace span (__) (A-value with larger imaginary part)

Answers

An eigenvector corresponding to λ₂ = 2 - i is v₂ = [-1, 1].

To find the eigenvalues of matrix A, we need to solve the characteristic equation det(A - λI) = 0, where I is the identity matrix.

Let's compute the determinant:

det(A - λI) = |[2 - λ -1]|

|[ 1 2 - λ]|

Expanding along the first row, we have:

(2 - λ)(2 - λ) - (-1)(1) = (2 - λ)² + 1 = λ² - 4λ + 5 = 0

To solve this quadratic equation, we can use the quadratic formula:

λ = (-(-4) ± √((-4)² - 4(1)(5))) / (2(1))

= (4 ± √(16 - 20)) / 2

= (4 ± √(-4)) / 2

Since we are working over the complex numbers, the square root of -4 is √(-4) = 2i.

λ₁ = (4 + 2i) / 2 = 2 + i

λ₂ = (4 - 2i) / 2 = 2 - i

Now, let's find the eigenvectors corresponding to each eigenvalue.

For λ₁ = 2 + i, we solve the equation (A - (2 + i)I)v = 0:

[2 - (2 + i) -1] [x] [0]

[ 1 2 - (2 + i)] [y] = [0]

Simplifying, we have:

[0 -1 -1] [x] [0]

[ 1 0 - i] [y] = [0]

From the first equation, we have -x - y = 0, which implies x = -y.

Choosing y = 1, we have x = -1.

Therefore, an eigenvector corresponding to λ₁ = 2 + i is v₁ = [-1, 1].

For λ₂ = 2 - i, we solve the equation (A - (2 - i)I)v = 0:

[2 - (2 - i) -1] [x] [0]

[ 1 2 - (2 - i)] [y] = [0]

Simplifying, we have:

[0 -1 -1] [x] [0]

[ 1 0 i] [y] = [0]

From the first equation, we have -x - y = 0, which implies x = -y.

Choosing y = 1, we have x = -1.

In summary:

λ₁ = 2 + i has eigenspace span {[-1, 1]}

λ₂ = 2 - i has eigenspace span {[-1, 1]}

Know more about eigenvector here:

https://brainly.com/question/31669528

#SPJ11

Find the general solution of the following:

dy/dt + 4/ty = e^t/t^3

Answers

The general solution of the differential equation dy/dt + 4/ty = e raised to power of t/t raised to power of 3:

y = C * e raised to power of t * t raised to power of 4

where C is an arbitrary constant.

To find this solution, we can use the following steps:

First, we can factor out e raised to power of t/t raised to power 3 from the right-hand side of the equation. This gives us:

dy/dt + 4/ty = e raised to power t/t raised to power of 3 * (1/t)

Next, we can multiply both sides of the equation by ty to get:

dy + 4 = e raised to power of t/t raised to power of 2

Now, we can integrate both sides of the equation. This gives us:

y + 4t = C * e raised to power of t

Finally, we can solve for y to get the general solution:

y = C * e raised to power of t * t raised to power of 4

where C is an arbitrary constant.

The first step of the solution is to factor out e raised to power t/t raised to power of 3 from the right-hand side of the equation. This is possible because the derivative of e raised to power of t/t raised to power of 3 is e raised to power of t/t raised to power of 3 * (1/t).

The second step of the solution is to multiply both sides of the equation by ty to get dy + 4 = e raised to power of t/t raised to power of 2. This is possible because the derivative of ty is t + y.

The third step of the solution is to integrate both sides of the equation. This gives us y + 4t = C * e raised to power of t. This is possible because the integral of dy is y and the integral of e raised to power t/t raised to power of 2 is -2e raised to power of t/t + C.

The fourth step of the solution is to solve for y to get the general solution y = C * e raised to power t * t raised to power of 4. This is possible by dividing both sides of the equation by C * e raised to power of t.

To learn more about differential equations click brainly.com/question/14620493

#SPJ11

Evaluate x-2 for x=-3

Answers

-3-2= -5

Put in -3 in x

Answer:

-5

Step-by-step explanation:

Rewrite x - 2 as -3 - 2, which comes out to -5.

The graph shown is a scatter plot:

A scatter plot is shown with the values on the x-axis in increasing units of 1 and the y-axis in increasing units of 10. The data moves in an upward cluster. Point A has coordinates 8 and 70. Point B has coordinates 1 and 20, point C has coordinates 3 and 40, point D has coordinates 7 and 30. Additional points are located at 2 and 10, 2 and 20, 3 and 30, 5 and 50, 5 and 40, 7 and 70, 7 and 60.
Which point on the scatter plot is an outlier? (4 points)

Group of answer choices

Point D

Point B

Point C

Point A

Answers

you’re answer is b.
i did this already

Answer:

D

Step-by-step explanation:

if we see on the graph, the point which is scattered is point D !
also took the FLVS test!!

sketch the strophoid shown below. r = sec() − 2 cos(), − 2 < < 2

Answers

The strophoid is a curve represented by the polar equation r = sec(θ) − 2cos(θ), where -2 < θ < 2. In Cartesian coordinates, the strophoid equation can be written as (x^2 + y^2)^2 = 4y^2(x + 2).

The strophoid has a unique shape characterized by its looped structure.

The strophoid is symmetric with respect to the y-axis, as changing θ to -θ gives the same value of r. It has two branches that intersect at the origin (0, 0). As θ increases from -2 to 2, the curve starts from the rightmost point of the loop, extends to the left, and then returns back to the rightmost point.

The loop of the strophoid is created by the interplay of the secant function, which stretches the curve away from the origin, and the cosine function, which pulls it towards the origin. The strophoid exhibits interesting geometric properties and is often used in mathematical modeling and visualization.

To learn more about intersect click here:

brainly.com/question/14217061

#SPJ11

cos80°.cos10°-sin80°.sin10°​

Answers

Step-by-step explanation:

The answer will be zero

here are the steps:

cos(90-10)xcos(90-80)-sin(90-10)xsin(90-10)=

(cos10xcos10)-(sin80xsin80)=

0.965111-0.965111=0

have a good day :)

I hope it will benefit you.

If AABC = ADEC,
ZB = 44º and ZE = 4x
A
B
С
E
x = [?]

Answers

Answer:

The angle at B is the same as the angle at E so equate them to each other to find x

2x+4=40°

2x=40-4

2x=36

x=36/2=18

Step-by-step explanation:

Hope this is helpful! stay safe and God Bless:)))


A sequence , satisfies the recurrence relation with
initial
conditions and . Find an explicit formula for the sequence.
+ k2 3) A sequence a,,a,,a z ..., satisfies the recurrence relation ax = 2x-1 + 2ax-2 with initial conditions a, = 2 and a = 7. Find an explicit formula for the sequence.

Answers

The explicit formula for the sequence [tex]\(a_n\)[/tex] is:

[tex]\(a_n = \begin{cases} 4n + 3 & \text{if } n \text{ is even} \\ 4n - 2 & \text{if } n \text{ is odd} \end{cases}\)[/tex]

To find an explicit formula for the sequence [tex]\(a_n\)[/tex] that satisfies the recurrence relation [tex]\(a_n = 2n-1 + 2a_{n-2}\)[/tex] with initial conditions [tex]\(a_1 = 2\)[/tex] and [tex]\(a_2 = 7\)[/tex], we can proceed as follows:

First, let's examine the first few terms of the sequence:

[tex]\(a_1 = 2\)\\\(a_2 = 7\)\\\(a_3 = 2(3) - 1 + 2a_1 = 5 + 2(2) = 9\)\\\(a_4 = 2(4) - 1 + 2a_2 = 8 + 2(7) = 22\)\\\(a_5 = 2(5) - 1 + 2a_3 = 9 + 2(9) = 27\)\\[/tex]

We can observe that the even-indexed terms [tex]\(a_2, a_4, a_6, \ldots\)[/tex] are increasing by a factor of 2, while the odd-indexed terms [tex]\(a_1, a_3, a_5, \ldots\)[/tex] are increasing by a factor of 3. This pattern suggests that we can split the sequence into two separate sequences:

For even-indexed terms:

[tex]\(b_n = a_{2n}\)[/tex]

For odd-indexed terms:

[tex]\(c_n = a_{2n-1}\)[/tex]

Let's find explicit formulas for both [tex](\(b_n\))[/tex] and [tex](\(c_n\))[/tex]:

1. Even-indexed terms [tex](\(b_n\))[/tex]:

The recurrence relation becomes:

[tex]\(b_n = 2(2n) - 1 + 2b_{n-1}\)[/tex]

To simplify the formula, let's rewrite [tex]\(b_n\)[/tex] as [tex]\(b_{n+1}\)[/tex] (i.e., shifting the index by 1):

[tex]\(b_{n+1} = 2(2n + 2) - 1 + 2b_{n}\)[/tex]

Subtracting the two equations, we get:

[tex]\(b_{n+1} - b_n = 4\)[/tex]

This is a simple arithmetic progression with a common difference of 4. To find an explicit formula for [tex]\(b_n\)[/tex], we can use the formula for the nth term of an arithmetic progression:

[tex]\(b_n = b_1 + (n - 1) \cdot \text{{common difference}}\)[/tex]

Substituting [tex]\(b_1 = a_2 = 7\)[/tex] and the common difference of 4, we have:

[tex]\(b_n = 7 + (n - 1) \cdot 4 = 4n + 3\)[/tex]

2. Odd-indexed terms [tex](\(c_n\))[/tex]:

The recurrence relation becomes:

[tex]\(c_n = 2(2n-1) - 1 + 2c_{n-1}\)[/tex]

Similar to before, let's rewrite [tex]\(c_n\)[/tex] as [tex]\(c_{n+1}\)[/tex]:

[tex]\(c_{n+1} = 2(2n + 1) - 1 + 2c_{n}\)[/tex]

Subtracting the two equations, we get:

[tex]\(c_{n+1} - c_n = 4\)[/tex]

Again, this is an arithmetic progression with a common difference of 4. Applying the formula for the nth term of an arithmetic progression:

[tex]\(c_n = c_1 + (n - 1) \cdot \text{{common difference}}\)[/tex]

Substituting [tex]\(c_1 = a_1 = 2\)[/tex] and the common difference of 4, we have:

[tex]\(c_n = 2 + (n - 1) \cdot 4 = 4n-2[/tex]

1) [tex]\cdot 4 = 4n - 2\)[/tex]

Now that we have explicit formulas for both [tex]\(b_n\)[/tex] and [tex]\(c_n\)[/tex], we can combine them to obtain the explicit formula for the original sequence [tex]\(a_n\)[/tex]:

For even-indexed terms, [tex]\(a_{2n} = b_n = 4n + 3\)[/tex]

For odd-indexed terms, [tex]\(a_{2n-1} = c_n = 4n - 2\)[/tex]

Therefore, the explicit formula for the sequence [tex]\(a_n\)[/tex] is:

[tex]\(a_n = \begin{cases} 4n + 3 & \text{if } n \text{ is even} \\ 4n - 2 & \text{if } n \text{ is odd} \end{cases}\)[/tex]

Learn more about Arithmetic Progression at:

https://brainly.com/question/30442577

#SPJ4

6th grade math help me pleaseeee

Answers

Answer:

3 CDs

Step-by-step explanation:

If we have $65 and buy a $23 DVD, we will have $42 left.

So how many $14 CDs can we buy with $42?

All we have to do is divide 42 into 14, so we know how many groups of $14 we can make with $42.

42 ÷ 14 = 3

Therefore, Michella can purchase 3 CDs.

For every six dollars that Jamal saves in his account, his brother saves eight dollars in his account.

If Jamal has $24.00 dollars in his account, how much money does his brother have in his account?

Answers

Answer:

jamel brother has 48.00 dollors

Step-by-step explanation:

Answer: He has 32$ 24 divided by 6 is 4 multiply 4 by 8 and you get 32

6th grade math plz help

Answers

A is the answer I believe

Arrange the following fraction from least to greatest 2/3, 5/6, 3/5
What did you do to arrange the fraction from least to greatest?

Answers

Answer:

2/3 and 3/5 is same, then 5/6

Step-by-step explanation:

you can convert the fractions to decimals to find their value and then arrange them from least to the greatest.

Answer:

3/5, 2/3, 5/6 [From Least to Greatest]

Step-by-step explanation:

First you're going to want to know which one is "the bigger piece of pie".

I made a few drawing and look at the pictures (Just in case you have a different opinion from my answer)

a is (4,15) and b is (8,1) what is the midpoint of AB?


Answers

Answer:

(6,8)

Step-by-step explanation:

midpoint=(x1+x2)÷2,(y1+y2)÷2

a(4,15) b(8,1)

x=4+8=12÷2=6

y=15+1=16÷2=8

Answer=(6,8)

Mohammed is x years old.
Holly is 3 years older than Mohamed.
Karen is twice as old as Mohamed.
The total of their ages is 51.
How old is Mohamed?

Answers

Step-by-step explanation:

Mohammed age = x

Holly age = x + 3

Karen age = 2x

given,

[tex]x + (x + 3) + 2x = 51 \\ x + x + 3 + 2x = 51 \\ 4x + 3 = 51 \\ 4x = 51 - 3 \\ 4x = 48 \\ x = 48 \div 4 \\ = 12[/tex]

6=2(y+2) i need help

Answers

Answer:

y=1

Step-by-step explanation:

6=2(y+2)

6=2y+4

2=2y

y=1

Answer:

y=1

Step-by-step explanation:

The scores on a psychology exam were normally distributed with a mean of 65 and a standard deviation of 6. What is the standard score for an exam score of 74?

Answers

Answer:

z = 1.5

Step-by-step explanation:

                               x - mean

standard score = -----------------

                                     6

Substituting 74 for x, 65 for mean, we get:

                               74 - 65

standard score = ----------------- = 9/6 = 1.5

                                     6

The pertinent z-score (standard score) is 1.5.

Answer:

Solution :-

Score = 74 - 65/6

Score = 9/6

Hence

Score is 9/6 or 1.5

[tex] \\ [/tex]

Please help me asap thanks

Answers

Answer:

x=3.5

Step-by-step explanation:

To make DEF similar to XYZ, the sides have to be in the same ratio. EF corresponds to YZ. EF=3, and YZ=4.5. The ratio 3:4.5 can be simplified to 2:3. Side DF corresponds to XZ.  DF=7 and XZ=3x. So, the ratio is 7:3x.

To  find x, we first find out what 3x is.  In this case 3x is 3(7/2)=10.5. So, x=10.5/3=3.5.

A faraway planet is populated by creatures called Jolos. All Jolos are either
green or purple and either one-headed or two-headed.
Balan, who lives on this planet, does a survey and finds that her colony of 500
contains 100 green, one-headed Jolos: 125 purple, two-headed Jolos; and
270 one headed Jolos.

Answers

Answer:

Option B

Step-by-step explanation:

We have to complete the table given in the question,

                         One headed               Two headed                    Total

Green                      100                       230 - 125 = 105        105 + 100 = 205

Purple            270 - 100 = 170                    125                      170 + 125 = 295

Total                         270                      500 - 270 = 230                500

By analyzing the given table,

Number of green Jolos in Balan's colony = Total of one headed green Jolos and Two headed green Jolos

= 205

Therefore, number of green Jolos in Balan's colony are 205.

Option B will be answer.

Answer:

When you put together the whole chart you will see the total is 205.

Since the arithmetic mean of the above data is 20, what is the span?
A) 45. B) 40. C) 35. D) 30​

Answers

Answer:

Step-by-step explanation:

help!!!! ^^^ due in 20 mins!

Answers

Answer:

I believe its 60cm squared

I’m not sure

Answer:

i think its 60cm

Step-by-step explanation:

I need the length of DB and Measure of angle C in degrees!!!!!

Answers

Answer:

DB = 10

m∡C = 106°

Step-by-step explanation:

DE = EB

20x - 8 = 16x + 12

4x = 20

x = 5

DB = 5 doubled, or 10

m∡A + m∡D = 180

3y + 7 + 2y + 8 = 180

5y + 15 = 180

5y = 165

y = 33

m∡A = m∡C

m∡A = 3(33)+7 = 106°

m∡C = 106° also

PLSS HELP IMMEDIATELY!!! i’ll give brainiest if u don’t leave a link!

Answers

D. Air Pockets in Their leaves

Those link sharing ppl are SOOOO annouing

Answer:

They have air-filled pockets in their leaves

Step-by-step explanation:

Plz help ASAP !!!!! Plzzz

Answers

Answer:

The second one

Step-by-step explanation:

She started with x dollars and then used 8 dollars to buy a football game ticket, so x-8. Then, she is left with 56 dollars, so x-8=56. Therefore, the second story represents the equation.

From the equation, find the axis of symmetry of the parabola.
y = 2x^2 + 4 x - 1

a. x = 3
b. x = -1
c. x = -3
d. x = 1

PLEASE HURRY!!! WILL MARK AS BRAINLIEST!!!

Answers

Answer:

C

Step-by-step explanation:

Ur welcome

The math club is selling T-shirts to raise money. Each T-shirt sold represents a profit of $2. The club has a total of 500 T-
shirts
If P() is the profit that the math club makes for selling T-shirts, a reasonable domain of this function is
<

Answers

Answer:

2 < or equal to (t) < or equal to 1000

Step-by-step explanation:

2 is the profit of the (t) amount of t shirts so the amount should be greater than or equal too 1000 because if they have 500 shirts 500 x 2 is 1000

The domain of this function will be given by the set A[1, 500].

What is the end behaviour of a function? What do you mean by domain and range of a function?

The end behavior of a function describes the trend of the graph if we look to the right end of the x-axis (as x approaches +∞ ) and to the left end of the x-axis (as x approaches −∞ ).

For any function y = f(x), Domain is the set of all possible values of [x] for which [y] exists. Range is the set of all values of [y] that exists for the given domain.

Given is the math club which is selling T-shirts to raise money. Each T-shirt sold represents a profit of $2. The club has a total of 500 T- shirts.

The function representing the profit by selling [x] T - shirts can be written as -

P(x) = 2x

or

y = 2x

Maximum value of y = 2x 500 = $1000

The domain of this function will be given by the set A[1, 500].

Hence, the domain of this function will be given by the set A[1, 500].

To solve more questions on functions, visit the link below -

brainly.com/question/1632425

#SPJ2

8.

Find the area of the shaded region.


A. 5x2 – 11x + 16

B. 5x2 + 7x – 26

C. 5x2 + 11x – 12

D. 5x2 + 7x – 20

Answers

Area of the shaded region = area of big square minus area of little square.

Here is the set up:

Let A_s = area of shaded region.

A_s = (2x + 2)(3x - 4) - [(x - 3)(x - 6)]

Take it from here.

Answer:

B. 5x2 + 7x – 26

Step-by-step explanation:  keeping in mind that the area of a rectangle is simply width * length, if we get the area of the larger rectangle, and then subtract the area of the smaller rectangle, we're in effect making a hole in the larger rectangle's area and thus what's leftover is the shaded area.

.................................................................................................................................

Answer:

Area = 5x^2 +7x -26

Step-by-step explanation:

The area of the shaded region can be found if you substruct the small rectangle from the big one. The area of any rectangle is calculated if you multiply width and height.

In other words:

A_small = (x-3)(x-6) = x^2-9x +18

A_big = (2x+2)(3x-4) = 6x^2 -2x -8

A_big - A_small = (6x^2 -2x -8) - (x^2-9x +18)

= 6x^2 -2x -8 - x^2 + 9x -18

= 5x^2 +7x -26

Other Questions
PLEASE HURRY:(After the end of World War II, nations met at the _______ to create a new worldwide economic system.Taxes on imports that make goods from foreign nations more expensive are called _______. When a country's currency loses value, prices increase and _______ happens.The IMF helps countries by providing _______ that need to be paid back at some point in the future.The program initiated by Mao to solidify his power and crush his opponents was called the _______.In the _______ massacre, the Chinese government killed hundreds of students for protesting and calling for democracy. _______ is the use of economic, political, and cultural pressures to control or influence other countries.Respond to the following based on your reading.Why did world leaders and economic advisors want to create a more global, interconnected economy?Do you agree or disagree that the new global economic order, facilitated by institutions like the IMF and the WTO, promoted neocolonialism? Provide evidence from the readings. can someone please help me Todd has a $100,000 25-year mortgage with a 12% nominal interest rate convertible monthly. The first payment is due one month after the mortgage is taken out. Twelve years after taking out the mortgage (after making his 144th payment), he refinances with a new nominal interest rate of 8%, again convertible monthly. The new mortgage will be paid off on the same date as the original one. Calculate the difference in the monthly mortgage payment after refinancing. An airplane traveling 919 m above the ocean at 505 m/s is to drop a case of twinkies to the victims below. How much time before being directly overhead should the box be dropped? What is the horizontal distance between the plane and the victims when the box is dropped? It is advertised that the average braking distance for a small car traveling at 65 miles per hour equals 120 feet. A transportation researcher wants to determine if the statement made in the advertisement is false. She randomly test drives 34 small cars at 65 miles per hour and records the braking distance. The sample average braking distance is computed as 115 feet. Assume that the population standard deviation is 20 feet. Use Table 1.Use = 0.01 to determine if the average braking distance differs from 120 feet. The average braking distance is (significantly/not significantly) different from 120 feet. Answer 2-5Please no links...... You invest $100 in a risky asset with an expected rate of return of 0.27 and a standard deviation of 0.36 and a T-bill with a rate of return of 0.05. The slope of the capital allocation line formed with the risky asset and the risk-free asset is equal toa. 0.05b. 1.3333c. 0.6111d. 0.7500 A manager samples the receipts of every fifth person who goes through the line. Out of 50 people, 5 had a mispriced item. If 1,000 people go to this store each day, how many people would you expect to have a mispriced item?You would expect there to be people per day who have a mispriced item. The tangent lines of a simple curve have azimuths 300 and bearing N 04 E, respectively. A third tangent line AB intersects the two tangent lines at bearing S 34 E. Stationing of the Pl of the curve is 16 + 464.35 and the distance from point B to the Pl of the curve is 277.6 m (ie BV = 277.6 m). Determine the following: a. Radius of the simple curve that shall be tangent to these three lines. b. Stationing of the PC Stationing of the PT Fill in the blank of the following sentence with the appropriate verb, conjugated correctly. (Only enter the missing word and not the entire sentence. Entering the entire sentence will be marked incorrectly.)Yo _______ (sweat) cuando corro. * Give the main function ofReproductive system in cattle company's cash-basis net income for the year ended december 31 was $75,000. the following information is from the company's accounting records: january 1 december 31 accounts receivable $15,000 $20,000 prepaid expenses 7,000 4,000 accrued liabilities 2,500 2,000 what is the accrual-basis net income? What do thermal energy and electrical energy have in common Write 'T' if the statement is true and 'F' if the statement is false in the respective boxes below. Question No 1 (T or F) 1. When a country faces a recession, the economy will most likely experiences falling employment and falling income. 2. If the economy is going into a recession, an appropriate fiscal policy is to decrease government spending. 3. An expansionary fiscal policy increases aggregate demand and increases real GDP. 4. A monetary policy is a policy that deals with government's income and expenditure. 5. Saudi Arabia Monetary Agency (SAMA) can conduct an expansionary monetary policy by lowering the reserve requirement. 6. Automatic stabilizers are a type of monetary policy that happen automatically and tend to offset fluctuations in economic activity without direct intervention from policymakers. 7. Government budget deficit occurs when government expenditure is more than government revenue. 8. Crowing-out effect refers to the additional shifts in aggregate demand curve that result when fiscal policy increases income and thereby decreases consumer spending. 9. Government intervention to increase the value of the Saudi Riyal is called revaluation. 10. Both closed economies and open economies interact freely with other economies around the world. Professor Ivy has given the following weights to her grades: Weight of Area Homework 5% Projects 25% Quiz 25% Exams 45% Your friend has the following averages: Homework: 95 Projects: 89 Quizzes: 80 Exams: 86 T/F if you take an antacid tablet, the ph in your stomach will increase. this means your stomach juice becomes more acidic. William built a machine that recycles metal. WhenWilliam places metal on the machine's conveyorbelt, the belt begins to move, pulling the metaltoward the rest of the machine. The machine usesenergy to break down the metal so it can be reused.What characteristics does William's machine sharewith living things?O A. The machine responds to its environmentand reproduces new machines of its ownkind.O B. The machine responds to its environmentand uses energy.O C. The machine reproduces new machines ofits own kind and uses energy.O D. The machine reproduces new machines ofits own kind and is made of cells. How do i do this and help me! Fast!!! help with segment relationships in circles...picture attatched. in what way is " Beasts of England " a national anthem for the animals